Now available: The Design and Implementation of the FreeBSD Operating System (Second Edition)
[ source navigation ] [ diff markup ] [ identifier search ] [ freetext search ] [ file search ] [ list types ] [ track identifier ]
FreeBSD/Linux Kernel Cross Reference
sys/dev/pci/pci.c
Version:
- FREEBSD - FREEBSD-13-STABLE - FREEBSD-13-0 - FREEBSD-12-STABLE - FREEBSD-12-0 - FREEBSD-11-STABLE - FREEBSD-11-0 - FREEBSD-10-STABLE - FREEBSD-10-0 - FREEBSD-9-STABLE - FREEBSD-9-0 - FREEBSD-8-STABLE - FREEBSD-8-0 - FREEBSD-7-STABLE - FREEBSD-7-0 - FREEBSD-6-STABLE - FREEBSD-6-0 - FREEBSD-5-STABLE - FREEBSD-5-0 - FREEBSD-4-STABLE - FREEBSD-3-STABLE - FREEBSD22 - l41 - OPENBSD - linux-2.6 - MK84 - PLAN9 - xnu-8792
SearchContext: - none - 3 - 10
SearchContext: - none - 3 - 10
1 /*- 2 * Copyright (c) 1997, Stefan Esser <se@freebsd.org> 3 * Copyright (c) 2000, Michael Smith <msmith@freebsd.org> 4 * Copyright (c) 2000, BSDi 5 * All rights reserved. 6 * 7 * Redistribution and use in source and binary forms, with or without 8 * modification, are permitted provided that the following conditions 9 * are met: 10 * 1. Redistributions of source code must retain the above copyright 11 * notice unmodified, this list of conditions, and the following 12 * disclaimer. 13 * 2. Redistributions in binary form must reproduce the above copyright 14 * notice, this list of conditions and the following disclaimer in the 15 * documentation and/or other materials provided with the distribution. 16 * 17 * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR 18 * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES 19 * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. 20 * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, 21 * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT 22 * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, 23 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY 24 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT 25 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF 26 * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. 27 */ 28 29 #include <sys/cdefs.h> 30 __FBSDID("$FreeBSD$"); 31 32 #include "opt_bus.h" 33 34 #include <sys/param.h> 35 #include <sys/systm.h> 36 #include <sys/malloc.h> 37 #include <sys/module.h> 38 #include <sys/linker.h> 39 #include <sys/fcntl.h> 40 #include <sys/conf.h> 41 #include <sys/kernel.h> 42 #include <sys/queue.h> 43 #include <sys/sysctl.h> 44 #include <sys/endian.h> 45 46 #include <vm/vm.h> 47 #include <vm/pmap.h> 48 #include <vm/vm_extern.h> 49 50 #include <sys/bus.h> 51 #include <machine/bus.h> 52 #include <sys/rman.h> 53 #include <machine/resource.h> 54 #include <machine/stdarg.h> 55 56 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 57 #include <machine/intr_machdep.h> 58 #endif 59 60 #include <sys/pciio.h> 61 #include <dev/pci/pcireg.h> 62 #include <dev/pci/pcivar.h> 63 #include <dev/pci/pci_private.h> 64 65 #include <dev/usb/controller/xhcireg.h> 66 #include <dev/usb/controller/ehcireg.h> 67 #include <dev/usb/controller/ohcireg.h> 68 #include <dev/usb/controller/uhcireg.h> 69 70 #include "pcib_if.h" 71 #include "pci_if.h" 72 73 /* 74 * XXX: Due to a limitation of the bus_dma_tag_create() API, we cannot 75 * specify a 4GB boundary on 32-bit targets. Usually this does not 76 * matter as it is ok to use a boundary of 0 on these systems. 77 * However, in the case of PAE, DMA addresses can cross a 4GB 78 * boundary, so as a workaround use a 2GB boundary. 79 */ 80 #if (BUS_SPACE_MAXADDR > 0xFFFFFFFF) 81 #ifdef PAE 82 #define PCI_DMA_BOUNDARY 0x80000000 83 #else 84 #define PCI_DMA_BOUNDARY 0x100000000 85 #endif 86 #endif 87 88 #define PCIR_IS_BIOS(cfg, reg) \ 89 (((cfg)->hdrtype == PCIM_HDRTYPE_NORMAL && reg == PCIR_BIOS) || \ 90 ((cfg)->hdrtype == PCIM_HDRTYPE_BRIDGE && reg == PCIR_BIOS_1)) 91 92 static int pci_has_quirk(uint32_t devid, int quirk); 93 static pci_addr_t pci_mapbase(uint64_t mapreg); 94 static const char *pci_maptype(uint64_t mapreg); 95 static int pci_mapsize(uint64_t testval); 96 static int pci_maprange(uint64_t mapreg); 97 static pci_addr_t pci_rombase(uint64_t mapreg); 98 static int pci_romsize(uint64_t testval); 99 static void pci_fixancient(pcicfgregs *cfg); 100 static int pci_printf(pcicfgregs *cfg, const char *fmt, ...); 101 102 static int pci_porten(device_t dev); 103 static int pci_memen(device_t dev); 104 static void pci_assign_interrupt(device_t bus, device_t dev, 105 int force_route); 106 static int pci_add_map(device_t bus, device_t dev, int reg, 107 struct resource_list *rl, int force, int prefetch); 108 static int pci_probe(device_t dev); 109 static int pci_attach(device_t dev); 110 static void pci_load_vendor_data(void); 111 static int pci_describe_parse_line(char **ptr, int *vendor, 112 int *device, char **desc); 113 static char *pci_describe_device(device_t dev); 114 static bus_dma_tag_t pci_get_dma_tag(device_t bus, device_t dev); 115 static int pci_modevent(module_t mod, int what, void *arg); 116 static void pci_hdrtypedata(device_t pcib, int b, int s, int f, 117 pcicfgregs *cfg); 118 static void pci_read_cap(device_t pcib, pcicfgregs *cfg); 119 static int pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, 120 int reg, uint32_t *data); 121 #if 0 122 static int pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, 123 int reg, uint32_t data); 124 #endif 125 static void pci_read_vpd(device_t pcib, pcicfgregs *cfg); 126 static void pci_disable_msi(device_t dev); 127 static void pci_enable_msi(device_t dev, uint64_t address, 128 uint16_t data); 129 static void pci_enable_msix(device_t dev, u_int index, 130 uint64_t address, uint32_t data); 131 static void pci_mask_msix(device_t dev, u_int index); 132 static void pci_unmask_msix(device_t dev, u_int index); 133 static int pci_msi_blacklisted(void); 134 static int pci_msix_blacklisted(void); 135 static void pci_resume_msi(device_t dev); 136 static void pci_resume_msix(device_t dev); 137 static int pci_remap_intr_method(device_t bus, device_t dev, 138 u_int irq); 139 140 static device_method_t pci_methods[] = { 141 /* Device interface */ 142 DEVMETHOD(device_probe, pci_probe), 143 DEVMETHOD(device_attach, pci_attach), 144 DEVMETHOD(device_detach, bus_generic_detach), 145 DEVMETHOD(device_shutdown, bus_generic_shutdown), 146 DEVMETHOD(device_suspend, pci_suspend), 147 DEVMETHOD(device_resume, pci_resume), 148 149 /* Bus interface */ 150 DEVMETHOD(bus_print_child, pci_print_child), 151 DEVMETHOD(bus_probe_nomatch, pci_probe_nomatch), 152 DEVMETHOD(bus_read_ivar, pci_read_ivar), 153 DEVMETHOD(bus_write_ivar, pci_write_ivar), 154 DEVMETHOD(bus_driver_added, pci_driver_added), 155 DEVMETHOD(bus_setup_intr, pci_setup_intr), 156 DEVMETHOD(bus_teardown_intr, pci_teardown_intr), 157 158 DEVMETHOD(bus_get_dma_tag, pci_get_dma_tag), 159 DEVMETHOD(bus_get_resource_list,pci_get_resource_list), 160 DEVMETHOD(bus_set_resource, bus_generic_rl_set_resource), 161 DEVMETHOD(bus_get_resource, bus_generic_rl_get_resource), 162 DEVMETHOD(bus_delete_resource, pci_delete_resource), 163 DEVMETHOD(bus_alloc_resource, pci_alloc_resource), 164 DEVMETHOD(bus_adjust_resource, bus_generic_adjust_resource), 165 DEVMETHOD(bus_release_resource, pci_release_resource), 166 DEVMETHOD(bus_activate_resource, pci_activate_resource), 167 DEVMETHOD(bus_deactivate_resource, pci_deactivate_resource), 168 DEVMETHOD(bus_child_pnpinfo_str, pci_child_pnpinfo_str_method), 169 DEVMETHOD(bus_child_location_str, pci_child_location_str_method), 170 DEVMETHOD(bus_remap_intr, pci_remap_intr_method), 171 172 /* PCI interface */ 173 DEVMETHOD(pci_read_config, pci_read_config_method), 174 DEVMETHOD(pci_write_config, pci_write_config_method), 175 DEVMETHOD(pci_enable_busmaster, pci_enable_busmaster_method), 176 DEVMETHOD(pci_disable_busmaster, pci_disable_busmaster_method), 177 DEVMETHOD(pci_enable_io, pci_enable_io_method), 178 DEVMETHOD(pci_disable_io, pci_disable_io_method), 179 DEVMETHOD(pci_get_vpd_ident, pci_get_vpd_ident_method), 180 DEVMETHOD(pci_get_vpd_readonly, pci_get_vpd_readonly_method), 181 DEVMETHOD(pci_get_powerstate, pci_get_powerstate_method), 182 DEVMETHOD(pci_set_powerstate, pci_set_powerstate_method), 183 DEVMETHOD(pci_assign_interrupt, pci_assign_interrupt_method), 184 DEVMETHOD(pci_find_extcap, pci_find_extcap_method), 185 DEVMETHOD(pci_alloc_msi, pci_alloc_msi_method), 186 DEVMETHOD(pci_alloc_msix, pci_alloc_msix_method), 187 DEVMETHOD(pci_remap_msix, pci_remap_msix_method), 188 DEVMETHOD(pci_release_msi, pci_release_msi_method), 189 DEVMETHOD(pci_msi_count, pci_msi_count_method), 190 DEVMETHOD(pci_msix_count, pci_msix_count_method), 191 192 DEVMETHOD_END 193 }; 194 195 DEFINE_CLASS_0(pci, pci_driver, pci_methods, sizeof(struct pci_softc)); 196 197 static devclass_t pci_devclass; 198 DRIVER_MODULE(pci, pcib, pci_driver, pci_devclass, pci_modevent, NULL); 199 MODULE_VERSION(pci, 1); 200 201 static char *pci_vendordata; 202 static size_t pci_vendordata_size; 203 204 struct pci_quirk { 205 uint32_t devid; /* Vendor/device of the card */ 206 int type; 207 #define PCI_QUIRK_MAP_REG 1 /* PCI map register in weird place */ 208 #define PCI_QUIRK_DISABLE_MSI 2 /* Neither MSI nor MSI-X work */ 209 #define PCI_QUIRK_ENABLE_MSI_VM 3 /* Older chipset in VM where MSI works */ 210 #define PCI_QUIRK_UNMAP_REG 4 /* Ignore PCI map register */ 211 #define PCI_QUIRK_DISABLE_MSIX 5 /* MSI-X doesn't work */ 212 #define PCI_QUIRK_MSI_INTX_BUG 6 /* PCIM_CMD_INTxDIS disables MSI */ 213 int arg1; 214 int arg2; 215 }; 216 217 static const struct pci_quirk pci_quirks[] = { 218 /* The Intel 82371AB and 82443MX have a map register at offset 0x90. */ 219 { 0x71138086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 220 { 0x719b8086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 221 /* As does the Serverworks OSB4 (the SMBus mapping register) */ 222 { 0x02001166, PCI_QUIRK_MAP_REG, 0x90, 0 }, 223 224 /* 225 * MSI doesn't work with the ServerWorks CNB20-HE Host Bridge 226 * or the CMIC-SL (AKA ServerWorks GC_LE). 227 */ 228 { 0x00141166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 229 { 0x00171166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 230 231 /* 232 * MSI doesn't work on earlier Intel chipsets including 233 * E7500, E7501, E7505, 845, 865, 875/E7210, and 855. 234 */ 235 { 0x25408086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 236 { 0x254c8086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 237 { 0x25508086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 238 { 0x25608086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 239 { 0x25708086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 240 { 0x25788086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 241 { 0x35808086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 242 243 /* 244 * MSI doesn't work with devices behind the AMD 8131 HT-PCIX 245 * bridge. 246 */ 247 { 0x74501022, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 248 249 /* 250 * MSI-X allocation doesn't work properly for devices passed through 251 * by VMware up to at least ESXi 5.1. 252 */ 253 { 0x079015ad, PCI_QUIRK_DISABLE_MSIX, 0, 0 }, /* PCI/PCI-X */ 254 { 0x07a015ad, PCI_QUIRK_DISABLE_MSIX, 0, 0 }, /* PCIe */ 255 256 /* 257 * Some virtualization environments emulate an older chipset 258 * but support MSI just fine. QEMU uses the Intel 82440. 259 */ 260 { 0x12378086, PCI_QUIRK_ENABLE_MSI_VM, 0, 0 }, 261 262 /* 263 * HPET MMIO base address may appear in Bar1 for AMD SB600 SMBus 264 * controller depending on SoftPciRst register (PM_IO 0x55 [7]). 265 * It prevents us from attaching hpet(4) when the bit is unset. 266 * Note this quirk only affects SB600 revision A13 and earlier. 267 * For SB600 A21 and later, firmware must set the bit to hide it. 268 * For SB700 and later, it is unused and hardcoded to zero. 269 */ 270 { 0x43851002, PCI_QUIRK_UNMAP_REG, 0x14, 0 }, 271 272 /* 273 * Atheros AR8161/AR8162/E2200 Ethernet controllers have a bug that 274 * MSI interrupt does not assert if PCIM_CMD_INTxDIS bit of the 275 * command register is set. 276 */ 277 { 0x10911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 278 { 0xE0911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 279 { 0x10901969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 280 281 /* 282 * Broadcom BCM5714(S)/BCM5715(S)/BCM5780(S) Ethernet MACs don't 283 * issue MSI interrupts with PCIM_CMD_INTxDIS set either. 284 */ 285 { 0x166814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714 */ 286 { 0x166914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714S */ 287 { 0x166a14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780 */ 288 { 0x166b14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780S */ 289 { 0x167814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715 */ 290 { 0x167914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715S */ 291 292 { 0 } 293 }; 294 295 /* map register information */ 296 #define PCI_MAPMEM 0x01 /* memory map */ 297 #define PCI_MAPMEMP 0x02 /* prefetchable memory map */ 298 #define PCI_MAPPORT 0x04 /* port map */ 299 300 struct devlist pci_devq; 301 uint32_t pci_generation; 302 uint32_t pci_numdevs = 0; 303 static int pcie_chipset, pcix_chipset; 304 305 /* sysctl vars */ 306 SYSCTL_NODE(_hw, OID_AUTO, pci, CTLFLAG_RD, 0, "PCI bus tuning parameters"); 307 308 static int pci_enable_io_modes = 1; 309 TUNABLE_INT("hw.pci.enable_io_modes", &pci_enable_io_modes); 310 SYSCTL_INT(_hw_pci, OID_AUTO, enable_io_modes, CTLFLAG_RW, 311 &pci_enable_io_modes, 1, 312 "Enable I/O and memory bits in the config register. Some BIOSes do not\n\ 313 enable these bits correctly. We'd like to do this all the time, but there\n\ 314 are some peripherals that this causes problems with."); 315 316 static int pci_do_realloc_bars = 0; 317 TUNABLE_INT("hw.pci.realloc_bars", &pci_do_realloc_bars); 318 SYSCTL_INT(_hw_pci, OID_AUTO, realloc_bars, CTLFLAG_RW, 319 &pci_do_realloc_bars, 0, 320 "Attempt to allocate a new range for any BARs whose original firmware-assigned ranges fail to allocate during the initial device scan."); 321 322 static int pci_do_power_nodriver = 0; 323 TUNABLE_INT("hw.pci.do_power_nodriver", &pci_do_power_nodriver); 324 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_nodriver, CTLFLAG_RW, 325 &pci_do_power_nodriver, 0, 326 "Place a function into D3 state when no driver attaches to it. 0 means\n\ 327 disable. 1 means conservatively place devices into D3 state. 2 means\n\ 328 agressively place devices into D3 state. 3 means put absolutely everything\n\ 329 in D3 state."); 330 331 int pci_do_power_resume = 1; 332 TUNABLE_INT("hw.pci.do_power_resume", &pci_do_power_resume); 333 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_resume, CTLFLAG_RW, 334 &pci_do_power_resume, 1, 335 "Transition from D3 -> D0 on resume."); 336 337 int pci_do_power_suspend = 1; 338 TUNABLE_INT("hw.pci.do_power_suspend", &pci_do_power_suspend); 339 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_suspend, CTLFLAG_RW, 340 &pci_do_power_suspend, 1, 341 "Transition from D0 -> D3 on suspend."); 342 343 static int pci_do_msi = 1; 344 TUNABLE_INT("hw.pci.enable_msi", &pci_do_msi); 345 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msi, CTLFLAG_RW, &pci_do_msi, 1, 346 "Enable support for MSI interrupts"); 347 348 static int pci_do_msix = 1; 349 TUNABLE_INT("hw.pci.enable_msix", &pci_do_msix); 350 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msix, CTLFLAG_RW, &pci_do_msix, 1, 351 "Enable support for MSI-X interrupts"); 352 353 static int pci_honor_msi_blacklist = 1; 354 TUNABLE_INT("hw.pci.honor_msi_blacklist", &pci_honor_msi_blacklist); 355 SYSCTL_INT(_hw_pci, OID_AUTO, honor_msi_blacklist, CTLFLAG_RD, 356 &pci_honor_msi_blacklist, 1, "Honor chipset blacklist for MSI/MSI-X"); 357 358 #if defined(__i386__) || defined(__amd64__) 359 static int pci_usb_takeover = 1; 360 #else 361 static int pci_usb_takeover = 0; 362 #endif 363 TUNABLE_INT("hw.pci.usb_early_takeover", &pci_usb_takeover); 364 SYSCTL_INT(_hw_pci, OID_AUTO, usb_early_takeover, CTLFLAG_RDTUN, 365 &pci_usb_takeover, 1, "Enable early takeover of USB controllers.\n\ 366 Disable this if you depend on BIOS emulation of USB devices, that is\n\ 367 you use USB devices (like keyboard or mouse) but do not load USB drivers"); 368 369 static int pci_clear_bars; 370 TUNABLE_INT("hw.pci.clear_bars", &pci_clear_bars); 371 SYSCTL_INT(_hw_pci, OID_AUTO, clear_bars, CTLFLAG_RDTUN, &pci_clear_bars, 0, 372 "Ignore firmware-assigned resources for BARs."); 373 374 static int 375 pci_has_quirk(uint32_t devid, int quirk) 376 { 377 const struct pci_quirk *q; 378 379 for (q = &pci_quirks[0]; q->devid; q++) { 380 if (q->devid == devid && q->type == quirk) 381 return (1); 382 } 383 return (0); 384 } 385 386 /* Find a device_t by bus/slot/function in domain 0 */ 387 388 device_t 389 pci_find_bsf(uint8_t bus, uint8_t slot, uint8_t func) 390 { 391 392 return (pci_find_dbsf(0, bus, slot, func)); 393 } 394 395 /* Find a device_t by domain/bus/slot/function */ 396 397 device_t 398 pci_find_dbsf(uint32_t domain, uint8_t bus, uint8_t slot, uint8_t func) 399 { 400 struct pci_devinfo *dinfo; 401 402 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 403 if ((dinfo->cfg.domain == domain) && 404 (dinfo->cfg.bus == bus) && 405 (dinfo->cfg.slot == slot) && 406 (dinfo->cfg.func == func)) { 407 return (dinfo->cfg.dev); 408 } 409 } 410 411 return (NULL); 412 } 413 414 /* Find a device_t by vendor/device ID */ 415 416 device_t 417 pci_find_device(uint16_t vendor, uint16_t device) 418 { 419 struct pci_devinfo *dinfo; 420 421 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 422 if ((dinfo->cfg.vendor == vendor) && 423 (dinfo->cfg.device == device)) { 424 return (dinfo->cfg.dev); 425 } 426 } 427 428 return (NULL); 429 } 430 431 device_t 432 pci_find_class(uint8_t class, uint8_t subclass) 433 { 434 struct pci_devinfo *dinfo; 435 436 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 437 if (dinfo->cfg.baseclass == class && 438 dinfo->cfg.subclass == subclass) { 439 return (dinfo->cfg.dev); 440 } 441 } 442 443 return (NULL); 444 } 445 446 static int 447 pci_printf(pcicfgregs *cfg, const char *fmt, ...) 448 { 449 va_list ap; 450 int retval; 451 452 retval = printf("pci%d:%d:%d:%d: ", cfg->domain, cfg->bus, cfg->slot, 453 cfg->func); 454 va_start(ap, fmt); 455 retval += vprintf(fmt, ap); 456 va_end(ap); 457 return (retval); 458 } 459 460 /* return base address of memory or port map */ 461 462 static pci_addr_t 463 pci_mapbase(uint64_t mapreg) 464 { 465 466 if (PCI_BAR_MEM(mapreg)) 467 return (mapreg & PCIM_BAR_MEM_BASE); 468 else 469 return (mapreg & PCIM_BAR_IO_BASE); 470 } 471 472 /* return map type of memory or port map */ 473 474 static const char * 475 pci_maptype(uint64_t mapreg) 476 { 477 478 if (PCI_BAR_IO(mapreg)) 479 return ("I/O Port"); 480 if (mapreg & PCIM_BAR_MEM_PREFETCH) 481 return ("Prefetchable Memory"); 482 return ("Memory"); 483 } 484 485 /* return log2 of map size decoded for memory or port map */ 486 487 static int 488 pci_mapsize(uint64_t testval) 489 { 490 int ln2size; 491 492 testval = pci_mapbase(testval); 493 ln2size = 0; 494 if (testval != 0) { 495 while ((testval & 1) == 0) 496 { 497 ln2size++; 498 testval >>= 1; 499 } 500 } 501 return (ln2size); 502 } 503 504 /* return base address of device ROM */ 505 506 static pci_addr_t 507 pci_rombase(uint64_t mapreg) 508 { 509 510 return (mapreg & PCIM_BIOS_ADDR_MASK); 511 } 512 513 /* return log2 of map size decided for device ROM */ 514 515 static int 516 pci_romsize(uint64_t testval) 517 { 518 int ln2size; 519 520 testval = pci_rombase(testval); 521 ln2size = 0; 522 if (testval != 0) { 523 while ((testval & 1) == 0) 524 { 525 ln2size++; 526 testval >>= 1; 527 } 528 } 529 return (ln2size); 530 } 531 532 /* return log2 of address range supported by map register */ 533 534 static int 535 pci_maprange(uint64_t mapreg) 536 { 537 int ln2range = 0; 538 539 if (PCI_BAR_IO(mapreg)) 540 ln2range = 32; 541 else 542 switch (mapreg & PCIM_BAR_MEM_TYPE) { 543 case PCIM_BAR_MEM_32: 544 ln2range = 32; 545 break; 546 case PCIM_BAR_MEM_1MB: 547 ln2range = 20; 548 break; 549 case PCIM_BAR_MEM_64: 550 ln2range = 64; 551 break; 552 } 553 return (ln2range); 554 } 555 556 /* adjust some values from PCI 1.0 devices to match 2.0 standards ... */ 557 558 static void 559 pci_fixancient(pcicfgregs *cfg) 560 { 561 if ((cfg->hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 562 return; 563 564 /* PCI to PCI bridges use header type 1 */ 565 if (cfg->baseclass == PCIC_BRIDGE && cfg->subclass == PCIS_BRIDGE_PCI) 566 cfg->hdrtype = PCIM_HDRTYPE_BRIDGE; 567 } 568 569 /* extract header type specific config data */ 570 571 static void 572 pci_hdrtypedata(device_t pcib, int b, int s, int f, pcicfgregs *cfg) 573 { 574 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 575 switch (cfg->hdrtype & PCIM_HDRTYPE) { 576 case PCIM_HDRTYPE_NORMAL: 577 cfg->subvendor = REG(PCIR_SUBVEND_0, 2); 578 cfg->subdevice = REG(PCIR_SUBDEV_0, 2); 579 cfg->nummaps = PCI_MAXMAPS_0; 580 break; 581 case PCIM_HDRTYPE_BRIDGE: 582 cfg->nummaps = PCI_MAXMAPS_1; 583 break; 584 case PCIM_HDRTYPE_CARDBUS: 585 cfg->subvendor = REG(PCIR_SUBVEND_2, 2); 586 cfg->subdevice = REG(PCIR_SUBDEV_2, 2); 587 cfg->nummaps = PCI_MAXMAPS_2; 588 break; 589 } 590 #undef REG 591 } 592 593 /* read configuration header into pcicfgregs structure */ 594 struct pci_devinfo * 595 pci_read_device(device_t pcib, int d, int b, int s, int f, size_t size) 596 { 597 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 598 pcicfgregs *cfg = NULL; 599 struct pci_devinfo *devlist_entry; 600 struct devlist *devlist_head; 601 602 devlist_head = &pci_devq; 603 604 devlist_entry = NULL; 605 606 if (REG(PCIR_DEVVENDOR, 4) != 0xfffffffful) { 607 devlist_entry = malloc(size, M_DEVBUF, M_WAITOK | M_ZERO); 608 609 cfg = &devlist_entry->cfg; 610 611 cfg->domain = d; 612 cfg->bus = b; 613 cfg->slot = s; 614 cfg->func = f; 615 cfg->vendor = REG(PCIR_VENDOR, 2); 616 cfg->device = REG(PCIR_DEVICE, 2); 617 cfg->cmdreg = REG(PCIR_COMMAND, 2); 618 cfg->statreg = REG(PCIR_STATUS, 2); 619 cfg->baseclass = REG(PCIR_CLASS, 1); 620 cfg->subclass = REG(PCIR_SUBCLASS, 1); 621 cfg->progif = REG(PCIR_PROGIF, 1); 622 cfg->revid = REG(PCIR_REVID, 1); 623 cfg->hdrtype = REG(PCIR_HDRTYPE, 1); 624 cfg->cachelnsz = REG(PCIR_CACHELNSZ, 1); 625 cfg->lattimer = REG(PCIR_LATTIMER, 1); 626 cfg->intpin = REG(PCIR_INTPIN, 1); 627 cfg->intline = REG(PCIR_INTLINE, 1); 628 629 cfg->mingnt = REG(PCIR_MINGNT, 1); 630 cfg->maxlat = REG(PCIR_MAXLAT, 1); 631 632 cfg->mfdev = (cfg->hdrtype & PCIM_MFDEV) != 0; 633 cfg->hdrtype &= ~PCIM_MFDEV; 634 STAILQ_INIT(&cfg->maps); 635 636 pci_fixancient(cfg); 637 pci_hdrtypedata(pcib, b, s, f, cfg); 638 639 if (REG(PCIR_STATUS, 2) & PCIM_STATUS_CAPPRESENT) 640 pci_read_cap(pcib, cfg); 641 642 STAILQ_INSERT_TAIL(devlist_head, devlist_entry, pci_links); 643 644 devlist_entry->conf.pc_sel.pc_domain = cfg->domain; 645 devlist_entry->conf.pc_sel.pc_bus = cfg->bus; 646 devlist_entry->conf.pc_sel.pc_dev = cfg->slot; 647 devlist_entry->conf.pc_sel.pc_func = cfg->func; 648 devlist_entry->conf.pc_hdr = cfg->hdrtype; 649 650 devlist_entry->conf.pc_subvendor = cfg->subvendor; 651 devlist_entry->conf.pc_subdevice = cfg->subdevice; 652 devlist_entry->conf.pc_vendor = cfg->vendor; 653 devlist_entry->conf.pc_device = cfg->device; 654 655 devlist_entry->conf.pc_class = cfg->baseclass; 656 devlist_entry->conf.pc_subclass = cfg->subclass; 657 devlist_entry->conf.pc_progif = cfg->progif; 658 devlist_entry->conf.pc_revid = cfg->revid; 659 660 pci_numdevs++; 661 pci_generation++; 662 } 663 return (devlist_entry); 664 #undef REG 665 } 666 667 static void 668 pci_read_cap(device_t pcib, pcicfgregs *cfg) 669 { 670 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, w) 671 #define WREG(n, v, w) PCIB_WRITE_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, v, w) 672 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 673 uint64_t addr; 674 #endif 675 uint32_t val; 676 int ptr, nextptr, ptrptr; 677 678 switch (cfg->hdrtype & PCIM_HDRTYPE) { 679 case PCIM_HDRTYPE_NORMAL: 680 case PCIM_HDRTYPE_BRIDGE: 681 ptrptr = PCIR_CAP_PTR; 682 break; 683 case PCIM_HDRTYPE_CARDBUS: 684 ptrptr = PCIR_CAP_PTR_2; /* cardbus capabilities ptr */ 685 break; 686 default: 687 return; /* no extended capabilities support */ 688 } 689 nextptr = REG(ptrptr, 1); /* sanity check? */ 690 691 /* 692 * Read capability entries. 693 */ 694 while (nextptr != 0) { 695 /* Sanity check */ 696 if (nextptr > 255) { 697 printf("illegal PCI extended capability offset %d\n", 698 nextptr); 699 return; 700 } 701 /* Find the next entry */ 702 ptr = nextptr; 703 nextptr = REG(ptr + PCICAP_NEXTPTR, 1); 704 705 /* Process this entry */ 706 switch (REG(ptr + PCICAP_ID, 1)) { 707 case PCIY_PMG: /* PCI power management */ 708 if (cfg->pp.pp_cap == 0) { 709 cfg->pp.pp_cap = REG(ptr + PCIR_POWER_CAP, 2); 710 cfg->pp.pp_status = ptr + PCIR_POWER_STATUS; 711 cfg->pp.pp_bse = ptr + PCIR_POWER_BSE; 712 if ((nextptr - ptr) > PCIR_POWER_DATA) 713 cfg->pp.pp_data = ptr + PCIR_POWER_DATA; 714 } 715 break; 716 case PCIY_HT: /* HyperTransport */ 717 /* Determine HT-specific capability type. */ 718 val = REG(ptr + PCIR_HT_COMMAND, 2); 719 720 if ((val & 0xe000) == PCIM_HTCAP_SLAVE) 721 cfg->ht.ht_slave = ptr; 722 723 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 724 switch (val & PCIM_HTCMD_CAP_MASK) { 725 case PCIM_HTCAP_MSI_MAPPING: 726 if (!(val & PCIM_HTCMD_MSI_FIXED)) { 727 /* Sanity check the mapping window. */ 728 addr = REG(ptr + PCIR_HTMSI_ADDRESS_HI, 729 4); 730 addr <<= 32; 731 addr |= REG(ptr + PCIR_HTMSI_ADDRESS_LO, 732 4); 733 if (addr != MSI_INTEL_ADDR_BASE) 734 device_printf(pcib, 735 "HT device at pci%d:%d:%d:%d has non-default MSI window 0x%llx\n", 736 cfg->domain, cfg->bus, 737 cfg->slot, cfg->func, 738 (long long)addr); 739 } else 740 addr = MSI_INTEL_ADDR_BASE; 741 742 cfg->ht.ht_msimap = ptr; 743 cfg->ht.ht_msictrl = val; 744 cfg->ht.ht_msiaddr = addr; 745 break; 746 } 747 #endif 748 break; 749 case PCIY_MSI: /* PCI MSI */ 750 cfg->msi.msi_location = ptr; 751 cfg->msi.msi_ctrl = REG(ptr + PCIR_MSI_CTRL, 2); 752 cfg->msi.msi_msgnum = 1 << ((cfg->msi.msi_ctrl & 753 PCIM_MSICTRL_MMC_MASK)>>1); 754 break; 755 case PCIY_MSIX: /* PCI MSI-X */ 756 cfg->msix.msix_location = ptr; 757 cfg->msix.msix_ctrl = REG(ptr + PCIR_MSIX_CTRL, 2); 758 cfg->msix.msix_msgnum = (cfg->msix.msix_ctrl & 759 PCIM_MSIXCTRL_TABLE_SIZE) + 1; 760 val = REG(ptr + PCIR_MSIX_TABLE, 4); 761 cfg->msix.msix_table_bar = PCIR_BAR(val & 762 PCIM_MSIX_BIR_MASK); 763 cfg->msix.msix_table_offset = val & ~PCIM_MSIX_BIR_MASK; 764 val = REG(ptr + PCIR_MSIX_PBA, 4); 765 cfg->msix.msix_pba_bar = PCIR_BAR(val & 766 PCIM_MSIX_BIR_MASK); 767 cfg->msix.msix_pba_offset = val & ~PCIM_MSIX_BIR_MASK; 768 break; 769 case PCIY_VPD: /* PCI Vital Product Data */ 770 cfg->vpd.vpd_reg = ptr; 771 break; 772 case PCIY_SUBVENDOR: 773 /* Should always be true. */ 774 if ((cfg->hdrtype & PCIM_HDRTYPE) == 775 PCIM_HDRTYPE_BRIDGE) { 776 val = REG(ptr + PCIR_SUBVENDCAP_ID, 4); 777 cfg->subvendor = val & 0xffff; 778 cfg->subdevice = val >> 16; 779 } 780 break; 781 case PCIY_PCIX: /* PCI-X */ 782 /* 783 * Assume we have a PCI-X chipset if we have 784 * at least one PCI-PCI bridge with a PCI-X 785 * capability. Note that some systems with 786 * PCI-express or HT chipsets might match on 787 * this check as well. 788 */ 789 if ((cfg->hdrtype & PCIM_HDRTYPE) == 790 PCIM_HDRTYPE_BRIDGE) 791 pcix_chipset = 1; 792 break; 793 case PCIY_EXPRESS: /* PCI-express */ 794 /* 795 * Assume we have a PCI-express chipset if we have 796 * at least one PCI-express device. 797 */ 798 pcie_chipset = 1; 799 cfg->pcie.pcie_location = ptr; 800 val = REG(ptr + PCIR_EXPRESS_FLAGS, 2); 801 cfg->pcie.pcie_type = val & PCIM_EXP_FLAGS_TYPE; 802 break; 803 default: 804 break; 805 } 806 } 807 808 #if defined(__powerpc__) 809 /* 810 * Enable the MSI mapping window for all HyperTransport 811 * slaves. PCI-PCI bridges have their windows enabled via 812 * PCIB_MAP_MSI(). 813 */ 814 if (cfg->ht.ht_slave != 0 && cfg->ht.ht_msimap != 0 && 815 !(cfg->ht.ht_msictrl & PCIM_HTCMD_MSI_ENABLE)) { 816 device_printf(pcib, 817 "Enabling MSI window for HyperTransport slave at pci%d:%d:%d:%d\n", 818 cfg->domain, cfg->bus, cfg->slot, cfg->func); 819 cfg->ht.ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 820 WREG(cfg->ht.ht_msimap + PCIR_HT_COMMAND, cfg->ht.ht_msictrl, 821 2); 822 } 823 #endif 824 /* REG and WREG use carry through to next functions */ 825 } 826 827 /* 828 * PCI Vital Product Data 829 */ 830 831 #define PCI_VPD_TIMEOUT 1000000 832 833 static int 834 pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t *data) 835 { 836 int count = PCI_VPD_TIMEOUT; 837 838 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 839 840 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg, 2); 841 842 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) != 0x8000) { 843 if (--count < 0) 844 return (ENXIO); 845 DELAY(1); /* limit looping */ 846 } 847 *data = (REG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, 4)); 848 849 return (0); 850 } 851 852 #if 0 853 static int 854 pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t data) 855 { 856 int count = PCI_VPD_TIMEOUT; 857 858 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 859 860 WREG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, data, 4); 861 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg | 0x8000, 2); 862 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) == 0x8000) { 863 if (--count < 0) 864 return (ENXIO); 865 DELAY(1); /* limit looping */ 866 } 867 868 return (0); 869 } 870 #endif 871 872 #undef PCI_VPD_TIMEOUT 873 874 struct vpd_readstate { 875 device_t pcib; 876 pcicfgregs *cfg; 877 uint32_t val; 878 int bytesinval; 879 int off; 880 uint8_t cksum; 881 }; 882 883 static int 884 vpd_nextbyte(struct vpd_readstate *vrs, uint8_t *data) 885 { 886 uint32_t reg; 887 uint8_t byte; 888 889 if (vrs->bytesinval == 0) { 890 if (pci_read_vpd_reg(vrs->pcib, vrs->cfg, vrs->off, ®)) 891 return (ENXIO); 892 vrs->val = le32toh(reg); 893 vrs->off += 4; 894 byte = vrs->val & 0xff; 895 vrs->bytesinval = 3; 896 } else { 897 vrs->val = vrs->val >> 8; 898 byte = vrs->val & 0xff; 899 vrs->bytesinval--; 900 } 901 902 vrs->cksum += byte; 903 *data = byte; 904 return (0); 905 } 906 907 static void 908 pci_read_vpd(device_t pcib, pcicfgregs *cfg) 909 { 910 struct vpd_readstate vrs; 911 int state; 912 int name; 913 int remain; 914 int i; 915 int alloc, off; /* alloc/off for RO/W arrays */ 916 int cksumvalid; 917 int dflen; 918 uint8_t byte; 919 uint8_t byte2; 920 921 /* init vpd reader */ 922 vrs.bytesinval = 0; 923 vrs.off = 0; 924 vrs.pcib = pcib; 925 vrs.cfg = cfg; 926 vrs.cksum = 0; 927 928 state = 0; 929 name = remain = i = 0; /* shut up stupid gcc */ 930 alloc = off = 0; /* shut up stupid gcc */ 931 dflen = 0; /* shut up stupid gcc */ 932 cksumvalid = -1; 933 while (state >= 0) { 934 if (vpd_nextbyte(&vrs, &byte)) { 935 state = -2; 936 break; 937 } 938 #if 0 939 printf("vpd: val: %#x, off: %d, bytesinval: %d, byte: %#hhx, " \ 940 "state: %d, remain: %d, name: %#x, i: %d\n", vrs.val, 941 vrs.off, vrs.bytesinval, byte, state, remain, name, i); 942 #endif 943 switch (state) { 944 case 0: /* item name */ 945 if (byte & 0x80) { 946 if (vpd_nextbyte(&vrs, &byte2)) { 947 state = -2; 948 break; 949 } 950 remain = byte2; 951 if (vpd_nextbyte(&vrs, &byte2)) { 952 state = -2; 953 break; 954 } 955 remain |= byte2 << 8; 956 if (remain > (0x7f*4 - vrs.off)) { 957 state = -1; 958 printf( 959 "pci%d:%d:%d:%d: invalid VPD data, remain %#x\n", 960 cfg->domain, cfg->bus, cfg->slot, 961 cfg->func, remain); 962 } 963 name = byte & 0x7f; 964 } else { 965 remain = byte & 0x7; 966 name = (byte >> 3) & 0xf; 967 } 968 switch (name) { 969 case 0x2: /* String */ 970 cfg->vpd.vpd_ident = malloc(remain + 1, 971 M_DEVBUF, M_WAITOK); 972 i = 0; 973 state = 1; 974 break; 975 case 0xf: /* End */ 976 state = -1; 977 break; 978 case 0x10: /* VPD-R */ 979 alloc = 8; 980 off = 0; 981 cfg->vpd.vpd_ros = malloc(alloc * 982 sizeof(*cfg->vpd.vpd_ros), M_DEVBUF, 983 M_WAITOK | M_ZERO); 984 state = 2; 985 break; 986 case 0x11: /* VPD-W */ 987 alloc = 8; 988 off = 0; 989 cfg->vpd.vpd_w = malloc(alloc * 990 sizeof(*cfg->vpd.vpd_w), M_DEVBUF, 991 M_WAITOK | M_ZERO); 992 state = 5; 993 break; 994 default: /* Invalid data, abort */ 995 state = -1; 996 break; 997 } 998 break; 999 1000 case 1: /* Identifier String */ 1001 cfg->vpd.vpd_ident[i++] = byte; 1002 remain--; 1003 if (remain == 0) { 1004 cfg->vpd.vpd_ident[i] = '\0'; 1005 state = 0; 1006 } 1007 break; 1008 1009 case 2: /* VPD-R Keyword Header */ 1010 if (off == alloc) { 1011 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1012 (alloc *= 2) * sizeof(*cfg->vpd.vpd_ros), 1013 M_DEVBUF, M_WAITOK | M_ZERO); 1014 } 1015 cfg->vpd.vpd_ros[off].keyword[0] = byte; 1016 if (vpd_nextbyte(&vrs, &byte2)) { 1017 state = -2; 1018 break; 1019 } 1020 cfg->vpd.vpd_ros[off].keyword[1] = byte2; 1021 if (vpd_nextbyte(&vrs, &byte2)) { 1022 state = -2; 1023 break; 1024 } 1025 cfg->vpd.vpd_ros[off].len = dflen = byte2; 1026 if (dflen == 0 && 1027 strncmp(cfg->vpd.vpd_ros[off].keyword, "RV", 1028 2) == 0) { 1029 /* 1030 * if this happens, we can't trust the rest 1031 * of the VPD. 1032 */ 1033 printf( 1034 "pci%d:%d:%d:%d: bad keyword length: %d\n", 1035 cfg->domain, cfg->bus, cfg->slot, 1036 cfg->func, dflen); 1037 cksumvalid = 0; 1038 state = -1; 1039 break; 1040 } else if (dflen == 0) { 1041 cfg->vpd.vpd_ros[off].value = malloc(1 * 1042 sizeof(*cfg->vpd.vpd_ros[off].value), 1043 M_DEVBUF, M_WAITOK); 1044 cfg->vpd.vpd_ros[off].value[0] = '\x00'; 1045 } else 1046 cfg->vpd.vpd_ros[off].value = malloc( 1047 (dflen + 1) * 1048 sizeof(*cfg->vpd.vpd_ros[off].value), 1049 M_DEVBUF, M_WAITOK); 1050 remain -= 3; 1051 i = 0; 1052 /* keep in sync w/ state 3's transistions */ 1053 if (dflen == 0 && remain == 0) 1054 state = 0; 1055 else if (dflen == 0) 1056 state = 2; 1057 else 1058 state = 3; 1059 break; 1060 1061 case 3: /* VPD-R Keyword Value */ 1062 cfg->vpd.vpd_ros[off].value[i++] = byte; 1063 if (strncmp(cfg->vpd.vpd_ros[off].keyword, 1064 "RV", 2) == 0 && cksumvalid == -1) { 1065 if (vrs.cksum == 0) 1066 cksumvalid = 1; 1067 else { 1068 if (bootverbose) 1069 printf( 1070 "pci%d:%d:%d:%d: bad VPD cksum, remain %hhu\n", 1071 cfg->domain, cfg->bus, 1072 cfg->slot, cfg->func, 1073 vrs.cksum); 1074 cksumvalid = 0; 1075 state = -1; 1076 break; 1077 } 1078 } 1079 dflen--; 1080 remain--; 1081 /* keep in sync w/ state 2's transistions */ 1082 if (dflen == 0) 1083 cfg->vpd.vpd_ros[off++].value[i++] = '\0'; 1084 if (dflen == 0 && remain == 0) { 1085 cfg->vpd.vpd_rocnt = off; 1086 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1087 off * sizeof(*cfg->vpd.vpd_ros), 1088 M_DEVBUF, M_WAITOK | M_ZERO); 1089 state = 0; 1090 } else if (dflen == 0) 1091 state = 2; 1092 break; 1093 1094 case 4: 1095 remain--; 1096 if (remain == 0) 1097 state = 0; 1098 break; 1099 1100 case 5: /* VPD-W Keyword Header */ 1101 if (off == alloc) { 1102 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1103 (alloc *= 2) * sizeof(*cfg->vpd.vpd_w), 1104 M_DEVBUF, M_WAITOK | M_ZERO); 1105 } 1106 cfg->vpd.vpd_w[off].keyword[0] = byte; 1107 if (vpd_nextbyte(&vrs, &byte2)) { 1108 state = -2; 1109 break; 1110 } 1111 cfg->vpd.vpd_w[off].keyword[1] = byte2; 1112 if (vpd_nextbyte(&vrs, &byte2)) { 1113 state = -2; 1114 break; 1115 } 1116 cfg->vpd.vpd_w[off].len = dflen = byte2; 1117 cfg->vpd.vpd_w[off].start = vrs.off - vrs.bytesinval; 1118 cfg->vpd.vpd_w[off].value = malloc((dflen + 1) * 1119 sizeof(*cfg->vpd.vpd_w[off].value), 1120 M_DEVBUF, M_WAITOK); 1121 remain -= 3; 1122 i = 0; 1123 /* keep in sync w/ state 6's transistions */ 1124 if (dflen == 0 && remain == 0) 1125 state = 0; 1126 else if (dflen == 0) 1127 state = 5; 1128 else 1129 state = 6; 1130 break; 1131 1132 case 6: /* VPD-W Keyword Value */ 1133 cfg->vpd.vpd_w[off].value[i++] = byte; 1134 dflen--; 1135 remain--; 1136 /* keep in sync w/ state 5's transistions */ 1137 if (dflen == 0) 1138 cfg->vpd.vpd_w[off++].value[i++] = '\0'; 1139 if (dflen == 0 && remain == 0) { 1140 cfg->vpd.vpd_wcnt = off; 1141 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1142 off * sizeof(*cfg->vpd.vpd_w), 1143 M_DEVBUF, M_WAITOK | M_ZERO); 1144 state = 0; 1145 } else if (dflen == 0) 1146 state = 5; 1147 break; 1148 1149 default: 1150 printf("pci%d:%d:%d:%d: invalid state: %d\n", 1151 cfg->domain, cfg->bus, cfg->slot, cfg->func, 1152 state); 1153 state = -1; 1154 break; 1155 } 1156 } 1157 1158 if (cksumvalid == 0 || state < -1) { 1159 /* read-only data bad, clean up */ 1160 if (cfg->vpd.vpd_ros != NULL) { 1161 for (off = 0; cfg->vpd.vpd_ros[off].value; off++) 1162 free(cfg->vpd.vpd_ros[off].value, M_DEVBUF); 1163 free(cfg->vpd.vpd_ros, M_DEVBUF); 1164 cfg->vpd.vpd_ros = NULL; 1165 } 1166 } 1167 if (state < -1) { 1168 /* I/O error, clean up */ 1169 printf("pci%d:%d:%d:%d: failed to read VPD data.\n", 1170 cfg->domain, cfg->bus, cfg->slot, cfg->func); 1171 if (cfg->vpd.vpd_ident != NULL) { 1172 free(cfg->vpd.vpd_ident, M_DEVBUF); 1173 cfg->vpd.vpd_ident = NULL; 1174 } 1175 if (cfg->vpd.vpd_w != NULL) { 1176 for (off = 0; cfg->vpd.vpd_w[off].value; off++) 1177 free(cfg->vpd.vpd_w[off].value, M_DEVBUF); 1178 free(cfg->vpd.vpd_w, M_DEVBUF); 1179 cfg->vpd.vpd_w = NULL; 1180 } 1181 } 1182 cfg->vpd.vpd_cached = 1; 1183 #undef REG 1184 #undef WREG 1185 } 1186 1187 int 1188 pci_get_vpd_ident_method(device_t dev, device_t child, const char **identptr) 1189 { 1190 struct pci_devinfo *dinfo = device_get_ivars(child); 1191 pcicfgregs *cfg = &dinfo->cfg; 1192 1193 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1194 pci_read_vpd(device_get_parent(dev), cfg); 1195 1196 *identptr = cfg->vpd.vpd_ident; 1197 1198 if (*identptr == NULL) 1199 return (ENXIO); 1200 1201 return (0); 1202 } 1203 1204 int 1205 pci_get_vpd_readonly_method(device_t dev, device_t child, const char *kw, 1206 const char **vptr) 1207 { 1208 struct pci_devinfo *dinfo = device_get_ivars(child); 1209 pcicfgregs *cfg = &dinfo->cfg; 1210 int i; 1211 1212 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1213 pci_read_vpd(device_get_parent(dev), cfg); 1214 1215 for (i = 0; i < cfg->vpd.vpd_rocnt; i++) 1216 if (memcmp(kw, cfg->vpd.vpd_ros[i].keyword, 1217 sizeof(cfg->vpd.vpd_ros[i].keyword)) == 0) { 1218 *vptr = cfg->vpd.vpd_ros[i].value; 1219 return (0); 1220 } 1221 1222 *vptr = NULL; 1223 return (ENXIO); 1224 } 1225 1226 struct pcicfg_vpd * 1227 pci_fetch_vpd_list(device_t dev) 1228 { 1229 struct pci_devinfo *dinfo = device_get_ivars(dev); 1230 pcicfgregs *cfg = &dinfo->cfg; 1231 1232 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1233 pci_read_vpd(device_get_parent(device_get_parent(dev)), cfg); 1234 return (&cfg->vpd); 1235 } 1236 1237 /* 1238 * Find the requested extended capability and return the offset in 1239 * configuration space via the pointer provided. The function returns 1240 * 0 on success and error code otherwise. 1241 */ 1242 int 1243 pci_find_extcap_method(device_t dev, device_t child, int capability, 1244 int *capreg) 1245 { 1246 struct pci_devinfo *dinfo = device_get_ivars(child); 1247 pcicfgregs *cfg = &dinfo->cfg; 1248 u_int32_t status; 1249 u_int8_t ptr; 1250 1251 /* 1252 * Check the CAP_LIST bit of the PCI status register first. 1253 */ 1254 status = pci_read_config(child, PCIR_STATUS, 2); 1255 if (!(status & PCIM_STATUS_CAPPRESENT)) 1256 return (ENXIO); 1257 1258 /* 1259 * Determine the start pointer of the capabilities list. 1260 */ 1261 switch (cfg->hdrtype & PCIM_HDRTYPE) { 1262 case PCIM_HDRTYPE_NORMAL: 1263 case PCIM_HDRTYPE_BRIDGE: 1264 ptr = PCIR_CAP_PTR; 1265 break; 1266 case PCIM_HDRTYPE_CARDBUS: 1267 ptr = PCIR_CAP_PTR_2; 1268 break; 1269 default: 1270 /* XXX: panic? */ 1271 return (ENXIO); /* no extended capabilities support */ 1272 } 1273 ptr = pci_read_config(child, ptr, 1); 1274 1275 /* 1276 * Traverse the capabilities list. 1277 */ 1278 while (ptr != 0) { 1279 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1280 if (capreg != NULL) 1281 *capreg = ptr; 1282 return (0); 1283 } 1284 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1285 } 1286 1287 return (ENOENT); 1288 } 1289 1290 /* 1291 * Support for MSI-X message interrupts. 1292 */ 1293 void 1294 pci_enable_msix(device_t dev, u_int index, uint64_t address, uint32_t data) 1295 { 1296 struct pci_devinfo *dinfo = device_get_ivars(dev); 1297 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1298 uint32_t offset; 1299 1300 KASSERT(msix->msix_table_len > index, ("bogus index")); 1301 offset = msix->msix_table_offset + index * 16; 1302 bus_write_4(msix->msix_table_res, offset, address & 0xffffffff); 1303 bus_write_4(msix->msix_table_res, offset + 4, address >> 32); 1304 bus_write_4(msix->msix_table_res, offset + 8, data); 1305 1306 /* Enable MSI -> HT mapping. */ 1307 pci_ht_map_msi(dev, address); 1308 } 1309 1310 void 1311 pci_mask_msix(device_t dev, u_int index) 1312 { 1313 struct pci_devinfo *dinfo = device_get_ivars(dev); 1314 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1315 uint32_t offset, val; 1316 1317 KASSERT(msix->msix_msgnum > index, ("bogus index")); 1318 offset = msix->msix_table_offset + index * 16 + 12; 1319 val = bus_read_4(msix->msix_table_res, offset); 1320 if (!(val & PCIM_MSIX_VCTRL_MASK)) { 1321 val |= PCIM_MSIX_VCTRL_MASK; 1322 bus_write_4(msix->msix_table_res, offset, val); 1323 } 1324 } 1325 1326 void 1327 pci_unmask_msix(device_t dev, u_int index) 1328 { 1329 struct pci_devinfo *dinfo = device_get_ivars(dev); 1330 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1331 uint32_t offset, val; 1332 1333 KASSERT(msix->msix_table_len > index, ("bogus index")); 1334 offset = msix->msix_table_offset + index * 16 + 12; 1335 val = bus_read_4(msix->msix_table_res, offset); 1336 if (val & PCIM_MSIX_VCTRL_MASK) { 1337 val &= ~PCIM_MSIX_VCTRL_MASK; 1338 bus_write_4(msix->msix_table_res, offset, val); 1339 } 1340 } 1341 1342 int 1343 pci_pending_msix(device_t dev, u_int index) 1344 { 1345 struct pci_devinfo *dinfo = device_get_ivars(dev); 1346 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1347 uint32_t offset, bit; 1348 1349 KASSERT(msix->msix_table_len > index, ("bogus index")); 1350 offset = msix->msix_pba_offset + (index / 32) * 4; 1351 bit = 1 << index % 32; 1352 return (bus_read_4(msix->msix_pba_res, offset) & bit); 1353 } 1354 1355 /* 1356 * Restore MSI-X registers and table during resume. If MSI-X is 1357 * enabled then walk the virtual table to restore the actual MSI-X 1358 * table. 1359 */ 1360 static void 1361 pci_resume_msix(device_t dev) 1362 { 1363 struct pci_devinfo *dinfo = device_get_ivars(dev); 1364 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1365 struct msix_table_entry *mte; 1366 struct msix_vector *mv; 1367 int i; 1368 1369 if (msix->msix_alloc > 0) { 1370 /* First, mask all vectors. */ 1371 for (i = 0; i < msix->msix_msgnum; i++) 1372 pci_mask_msix(dev, i); 1373 1374 /* Second, program any messages with at least one handler. */ 1375 for (i = 0; i < msix->msix_table_len; i++) { 1376 mte = &msix->msix_table[i]; 1377 if (mte->mte_vector == 0 || mte->mte_handlers == 0) 1378 continue; 1379 mv = &msix->msix_vectors[mte->mte_vector - 1]; 1380 pci_enable_msix(dev, i, mv->mv_address, mv->mv_data); 1381 pci_unmask_msix(dev, i); 1382 } 1383 } 1384 pci_write_config(dev, msix->msix_location + PCIR_MSIX_CTRL, 1385 msix->msix_ctrl, 2); 1386 } 1387 1388 /* 1389 * Attempt to allocate *count MSI-X messages. The actual number allocated is 1390 * returned in *count. After this function returns, each message will be 1391 * available to the driver as SYS_RES_IRQ resources starting at rid 1. 1392 */ 1393 int 1394 pci_alloc_msix_method(device_t dev, device_t child, int *count) 1395 { 1396 struct pci_devinfo *dinfo = device_get_ivars(child); 1397 pcicfgregs *cfg = &dinfo->cfg; 1398 struct resource_list_entry *rle; 1399 int actual, error, i, irq, max; 1400 1401 /* Don't let count == 0 get us into trouble. */ 1402 if (*count == 0) 1403 return (EINVAL); 1404 1405 /* If rid 0 is allocated, then fail. */ 1406 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 1407 if (rle != NULL && rle->res != NULL) 1408 return (ENXIO); 1409 1410 /* Already have allocated messages? */ 1411 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 1412 return (ENXIO); 1413 1414 /* If MSI-X is blacklisted for this system, fail. */ 1415 if (pci_msix_blacklisted()) 1416 return (ENXIO); 1417 1418 /* MSI-X capability present? */ 1419 if (cfg->msix.msix_location == 0 || !pci_do_msix) 1420 return (ENODEV); 1421 1422 /* Make sure the appropriate BARs are mapped. */ 1423 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1424 cfg->msix.msix_table_bar); 1425 if (rle == NULL || rle->res == NULL || 1426 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1427 return (ENXIO); 1428 cfg->msix.msix_table_res = rle->res; 1429 if (cfg->msix.msix_pba_bar != cfg->msix.msix_table_bar) { 1430 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1431 cfg->msix.msix_pba_bar); 1432 if (rle == NULL || rle->res == NULL || 1433 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1434 return (ENXIO); 1435 } 1436 cfg->msix.msix_pba_res = rle->res; 1437 1438 if (bootverbose) 1439 device_printf(child, 1440 "attempting to allocate %d MSI-X vectors (%d supported)\n", 1441 *count, cfg->msix.msix_msgnum); 1442 max = min(*count, cfg->msix.msix_msgnum); 1443 for (i = 0; i < max; i++) { 1444 /* Allocate a message. */ 1445 error = PCIB_ALLOC_MSIX(device_get_parent(dev), child, &irq); 1446 if (error) { 1447 if (i == 0) 1448 return (error); 1449 break; 1450 } 1451 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 1452 irq, 1); 1453 } 1454 actual = i; 1455 1456 if (bootverbose) { 1457 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 1); 1458 if (actual == 1) 1459 device_printf(child, "using IRQ %lu for MSI-X\n", 1460 rle->start); 1461 else { 1462 int run; 1463 1464 /* 1465 * Be fancy and try to print contiguous runs of 1466 * IRQ values as ranges. 'irq' is the previous IRQ. 1467 * 'run' is true if we are in a range. 1468 */ 1469 device_printf(child, "using IRQs %lu", rle->start); 1470 irq = rle->start; 1471 run = 0; 1472 for (i = 1; i < actual; i++) { 1473 rle = resource_list_find(&dinfo->resources, 1474 SYS_RES_IRQ, i + 1); 1475 1476 /* Still in a run? */ 1477 if (rle->start == irq + 1) { 1478 run = 1; 1479 irq++; 1480 continue; 1481 } 1482 1483 /* Finish previous range. */ 1484 if (run) { 1485 printf("-%d", irq); 1486 run = 0; 1487 } 1488 1489 /* Start new range. */ 1490 printf(",%lu", rle->start); 1491 irq = rle->start; 1492 } 1493 1494 /* Unfinished range? */ 1495 if (run) 1496 printf("-%d", irq); 1497 printf(" for MSI-X\n"); 1498 } 1499 } 1500 1501 /* Mask all vectors. */ 1502 for (i = 0; i < cfg->msix.msix_msgnum; i++) 1503 pci_mask_msix(child, i); 1504 1505 /* Allocate and initialize vector data and virtual table. */ 1506 cfg->msix.msix_vectors = malloc(sizeof(struct msix_vector) * actual, 1507 M_DEVBUF, M_WAITOK | M_ZERO); 1508 cfg->msix.msix_table = malloc(sizeof(struct msix_table_entry) * actual, 1509 M_DEVBUF, M_WAITOK | M_ZERO); 1510 for (i = 0; i < actual; i++) { 1511 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1512 cfg->msix.msix_vectors[i].mv_irq = rle->start; 1513 cfg->msix.msix_table[i].mte_vector = i + 1; 1514 } 1515 1516 /* Update control register to enable MSI-X. */ 1517 cfg->msix.msix_ctrl |= PCIM_MSIXCTRL_MSIX_ENABLE; 1518 pci_write_config(child, cfg->msix.msix_location + PCIR_MSIX_CTRL, 1519 cfg->msix.msix_ctrl, 2); 1520 1521 /* Update counts of alloc'd messages. */ 1522 cfg->msix.msix_alloc = actual; 1523 cfg->msix.msix_table_len = actual; 1524 *count = actual; 1525 return (0); 1526 } 1527 1528 /* 1529 * By default, pci_alloc_msix() will assign the allocated IRQ 1530 * resources consecutively to the first N messages in the MSI-X table. 1531 * However, device drivers may want to use different layouts if they 1532 * either receive fewer messages than they asked for, or they wish to 1533 * populate the MSI-X table sparsely. This method allows the driver 1534 * to specify what layout it wants. It must be called after a 1535 * successful pci_alloc_msix() but before any of the associated 1536 * SYS_RES_IRQ resources are allocated via bus_alloc_resource(). 1537 * 1538 * The 'vectors' array contains 'count' message vectors. The array 1539 * maps directly to the MSI-X table in that index 0 in the array 1540 * specifies the vector for the first message in the MSI-X table, etc. 1541 * The vector value in each array index can either be 0 to indicate 1542 * that no vector should be assigned to a message slot, or it can be a 1543 * number from 1 to N (where N is the count returned from a 1544 * succcessful call to pci_alloc_msix()) to indicate which message 1545 * vector (IRQ) to be used for the corresponding message. 1546 * 1547 * On successful return, each message with a non-zero vector will have 1548 * an associated SYS_RES_IRQ whose rid is equal to the array index + 1549 * 1. Additionally, if any of the IRQs allocated via the previous 1550 * call to pci_alloc_msix() are not used in the mapping, those IRQs 1551 * will be freed back to the system automatically. 1552 * 1553 * For example, suppose a driver has a MSI-X table with 6 messages and 1554 * asks for 6 messages, but pci_alloc_msix() only returns a count of 1555 * 3. Call the three vectors allocated by pci_alloc_msix() A, B, and 1556 * C. After the call to pci_alloc_msix(), the device will be setup to 1557 * have an MSI-X table of ABC--- (where - means no vector assigned). 1558 * If the driver ten passes a vector array of { 1, 0, 1, 2, 0, 2 }, 1559 * then the MSI-X table will look like A-AB-B, and the 'C' vector will 1560 * be freed back to the system. This device will also have valid 1561 * SYS_RES_IRQ rids of 1, 3, 4, and 6. 1562 * 1563 * In any case, the SYS_RES_IRQ rid X will always map to the message 1564 * at MSI-X table index X - 1 and will only be valid if a vector is 1565 * assigned to that table entry. 1566 */ 1567 int 1568 pci_remap_msix_method(device_t dev, device_t child, int count, 1569 const u_int *vectors) 1570 { 1571 struct pci_devinfo *dinfo = device_get_ivars(child); 1572 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1573 struct resource_list_entry *rle; 1574 int i, irq, j, *used; 1575 1576 /* 1577 * Have to have at least one message in the table but the 1578 * table can't be bigger than the actual MSI-X table in the 1579 * device. 1580 */ 1581 if (count == 0 || count > msix->msix_msgnum) 1582 return (EINVAL); 1583 1584 /* Sanity check the vectors. */ 1585 for (i = 0; i < count; i++) 1586 if (vectors[i] > msix->msix_alloc) 1587 return (EINVAL); 1588 1589 /* 1590 * Make sure there aren't any holes in the vectors to be used. 1591 * It's a big pain to support it, and it doesn't really make 1592 * sense anyway. Also, at least one vector must be used. 1593 */ 1594 used = malloc(sizeof(int) * msix->msix_alloc, M_DEVBUF, M_WAITOK | 1595 M_ZERO); 1596 for (i = 0; i < count; i++) 1597 if (vectors[i] != 0) 1598 used[vectors[i] - 1] = 1; 1599 for (i = 0; i < msix->msix_alloc - 1; i++) 1600 if (used[i] == 0 && used[i + 1] == 1) { 1601 free(used, M_DEVBUF); 1602 return (EINVAL); 1603 } 1604 if (used[0] != 1) { 1605 free(used, M_DEVBUF); 1606 return (EINVAL); 1607 } 1608 1609 /* Make sure none of the resources are allocated. */ 1610 for (i = 0; i < msix->msix_table_len; i++) { 1611 if (msix->msix_table[i].mte_vector == 0) 1612 continue; 1613 if (msix->msix_table[i].mte_handlers > 0) 1614 return (EBUSY); 1615 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1616 KASSERT(rle != NULL, ("missing resource")); 1617 if (rle->res != NULL) 1618 return (EBUSY); 1619 } 1620 1621 /* Free the existing resource list entries. */ 1622 for (i = 0; i < msix->msix_table_len; i++) { 1623 if (msix->msix_table[i].mte_vector == 0) 1624 continue; 1625 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 1626 } 1627 1628 /* 1629 * Build the new virtual table keeping track of which vectors are 1630 * used. 1631 */ 1632 free(msix->msix_table, M_DEVBUF); 1633 msix->msix_table = malloc(sizeof(struct msix_table_entry) * count, 1634 M_DEVBUF, M_WAITOK | M_ZERO); 1635 for (i = 0; i < count; i++) 1636 msix->msix_table[i].mte_vector = vectors[i]; 1637 msix->msix_table_len = count; 1638 1639 /* Free any unused IRQs and resize the vectors array if necessary. */ 1640 j = msix->msix_alloc - 1; 1641 if (used[j] == 0) { 1642 struct msix_vector *vec; 1643 1644 while (used[j] == 0) { 1645 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 1646 msix->msix_vectors[j].mv_irq); 1647 j--; 1648 } 1649 vec = malloc(sizeof(struct msix_vector) * (j + 1), M_DEVBUF, 1650 M_WAITOK); 1651 bcopy(msix->msix_vectors, vec, sizeof(struct msix_vector) * 1652 (j + 1)); 1653 free(msix->msix_vectors, M_DEVBUF); 1654 msix->msix_vectors = vec; 1655 msix->msix_alloc = j + 1; 1656 } 1657 free(used, M_DEVBUF); 1658 1659 /* Map the IRQs onto the rids. */ 1660 for (i = 0; i < count; i++) { 1661 if (vectors[i] == 0) 1662 continue; 1663 irq = msix->msix_vectors[vectors[i] - 1].mv_irq; 1664 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 1665 irq, 1); 1666 } 1667 1668 if (bootverbose) { 1669 device_printf(child, "Remapped MSI-X IRQs as: "); 1670 for (i = 0; i < count; i++) { 1671 if (i != 0) 1672 printf(", "); 1673 if (vectors[i] == 0) 1674 printf("---"); 1675 else 1676 printf("%d", 1677 msix->msix_vectors[vectors[i] - 1].mv_irq); 1678 } 1679 printf("\n"); 1680 } 1681 1682 return (0); 1683 } 1684 1685 static int 1686 pci_release_msix(device_t dev, device_t child) 1687 { 1688 struct pci_devinfo *dinfo = device_get_ivars(child); 1689 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1690 struct resource_list_entry *rle; 1691 int i; 1692 1693 /* Do we have any messages to release? */ 1694 if (msix->msix_alloc == 0) 1695 return (ENODEV); 1696 1697 /* Make sure none of the resources are allocated. */ 1698 for (i = 0; i < msix->msix_table_len; i++) { 1699 if (msix->msix_table[i].mte_vector == 0) 1700 continue; 1701 if (msix->msix_table[i].mte_handlers > 0) 1702 return (EBUSY); 1703 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1704 KASSERT(rle != NULL, ("missing resource")); 1705 if (rle->res != NULL) 1706 return (EBUSY); 1707 } 1708 1709 /* Update control register to disable MSI-X. */ 1710 msix->msix_ctrl &= ~PCIM_MSIXCTRL_MSIX_ENABLE; 1711 pci_write_config(child, msix->msix_location + PCIR_MSIX_CTRL, 1712 msix->msix_ctrl, 2); 1713 1714 /* Free the resource list entries. */ 1715 for (i = 0; i < msix->msix_table_len; i++) { 1716 if (msix->msix_table[i].mte_vector == 0) 1717 continue; 1718 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 1719 } 1720 free(msix->msix_table, M_DEVBUF); 1721 msix->msix_table_len = 0; 1722 1723 /* Release the IRQs. */ 1724 for (i = 0; i < msix->msix_alloc; i++) 1725 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 1726 msix->msix_vectors[i].mv_irq); 1727 free(msix->msix_vectors, M_DEVBUF); 1728 msix->msix_alloc = 0; 1729 return (0); 1730 } 1731 1732 /* 1733 * Return the max supported MSI-X messages this device supports. 1734 * Basically, assuming the MD code can alloc messages, this function 1735 * should return the maximum value that pci_alloc_msix() can return. 1736 * Thus, it is subject to the tunables, etc. 1737 */ 1738 int 1739 pci_msix_count_method(device_t dev, device_t child) 1740 { 1741 struct pci_devinfo *dinfo = device_get_ivars(child); 1742 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1743 1744 if (pci_do_msix && msix->msix_location != 0) 1745 return (msix->msix_msgnum); 1746 return (0); 1747 } 1748 1749 /* 1750 * HyperTransport MSI mapping control 1751 */ 1752 void 1753 pci_ht_map_msi(device_t dev, uint64_t addr) 1754 { 1755 struct pci_devinfo *dinfo = device_get_ivars(dev); 1756 struct pcicfg_ht *ht = &dinfo->cfg.ht; 1757 1758 if (!ht->ht_msimap) 1759 return; 1760 1761 if (addr && !(ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) && 1762 ht->ht_msiaddr >> 20 == addr >> 20) { 1763 /* Enable MSI -> HT mapping. */ 1764 ht->ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 1765 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 1766 ht->ht_msictrl, 2); 1767 } 1768 1769 if (!addr && ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) { 1770 /* Disable MSI -> HT mapping. */ 1771 ht->ht_msictrl &= ~PCIM_HTCMD_MSI_ENABLE; 1772 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 1773 ht->ht_msictrl, 2); 1774 } 1775 } 1776 1777 int 1778 pci_get_max_payload(device_t dev) 1779 { 1780 struct pci_devinfo *dinfo = device_get_ivars(dev); 1781 int cap; 1782 uint16_t val; 1783 1784 cap = dinfo->cfg.pcie.pcie_location; 1785 if (cap == 0) 1786 return (0); 1787 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 1788 val &= PCIEM_CTL_MAX_PAYLOAD; 1789 val >>= 5; 1790 return (1 << (val + 7)); 1791 } 1792 1793 int 1794 pci_get_max_read_req(device_t dev) 1795 { 1796 struct pci_devinfo *dinfo = device_get_ivars(dev); 1797 int cap; 1798 uint16_t val; 1799 1800 cap = dinfo->cfg.pcie.pcie_location; 1801 if (cap == 0) 1802 return (0); 1803 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 1804 val &= PCIEM_CTL_MAX_READ_REQUEST; 1805 val >>= 12; 1806 return (1 << (val + 7)); 1807 } 1808 1809 int 1810 pci_set_max_read_req(device_t dev, int size) 1811 { 1812 struct pci_devinfo *dinfo = device_get_ivars(dev); 1813 int cap; 1814 uint16_t val; 1815 1816 cap = dinfo->cfg.pcie.pcie_location; 1817 if (cap == 0) 1818 return (0); 1819 if (size < 128) 1820 size = 128; 1821 if (size > 4096) 1822 size = 4096; 1823 size = (1 << (fls(size) - 1)); 1824 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 1825 val &= ~PCIEM_CTL_MAX_READ_REQUEST; 1826 val |= (fls(size) - 8) << 12; 1827 pci_write_config(dev, cap + PCIER_DEVICE_CTL, val, 2); 1828 return (size); 1829 } 1830 1831 uint32_t 1832 pcie_read_config(device_t dev, int reg, int width) 1833 { 1834 struct pci_devinfo *dinfo = device_get_ivars(dev); 1835 int cap; 1836 1837 cap = dinfo->cfg.pcie.pcie_location; 1838 if (cap == 0) { 1839 if (width == 2) 1840 return (0xffff); 1841 return (0xffffffff); 1842 } 1843 1844 return (pci_read_config(dev, cap + reg, width)); 1845 } 1846 1847 void 1848 pcie_write_config(device_t dev, int reg, uint32_t value, int width) 1849 { 1850 struct pci_devinfo *dinfo = device_get_ivars(dev); 1851 int cap; 1852 1853 cap = dinfo->cfg.pcie.pcie_location; 1854 if (cap == 0) 1855 return; 1856 pci_write_config(dev, cap + reg, value, width); 1857 } 1858 1859 /* 1860 * Adjusts a PCI-e capability register by clearing the bits in mask 1861 * and setting the bits in (value & mask). Bits not set in mask are 1862 * not adjusted. 1863 * 1864 * Returns the old value on success or all ones on failure. 1865 */ 1866 uint32_t 1867 pcie_adjust_config(device_t dev, int reg, uint32_t mask, uint32_t value, 1868 int width) 1869 { 1870 struct pci_devinfo *dinfo = device_get_ivars(dev); 1871 uint32_t old, new; 1872 int cap; 1873 1874 cap = dinfo->cfg.pcie.pcie_location; 1875 if (cap == 0) { 1876 if (width == 2) 1877 return (0xffff); 1878 return (0xffffffff); 1879 } 1880 1881 old = pci_read_config(dev, cap + reg, width); 1882 new = old & ~mask; 1883 new |= (value & mask); 1884 pci_write_config(dev, cap + reg, new, width); 1885 return (old); 1886 } 1887 1888 /* 1889 * Support for MSI message signalled interrupts. 1890 */ 1891 void 1892 pci_enable_msi(device_t dev, uint64_t address, uint16_t data) 1893 { 1894 struct pci_devinfo *dinfo = device_get_ivars(dev); 1895 struct pcicfg_msi *msi = &dinfo->cfg.msi; 1896 1897 /* Write data and address values. */ 1898 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR, 1899 address & 0xffffffff, 4); 1900 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 1901 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR_HIGH, 1902 address >> 32, 4); 1903 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA_64BIT, 1904 data, 2); 1905 } else 1906 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA, data, 1907 2); 1908 1909 /* Enable MSI in the control register. */ 1910 msi->msi_ctrl |= PCIM_MSICTRL_MSI_ENABLE; 1911 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 1912 2); 1913 1914 /* Enable MSI -> HT mapping. */ 1915 pci_ht_map_msi(dev, address); 1916 } 1917 1918 void 1919 pci_disable_msi(device_t dev) 1920 { 1921 struct pci_devinfo *dinfo = device_get_ivars(dev); 1922 struct pcicfg_msi *msi = &dinfo->cfg.msi; 1923 1924 /* Disable MSI -> HT mapping. */ 1925 pci_ht_map_msi(dev, 0); 1926 1927 /* Disable MSI in the control register. */ 1928 msi->msi_ctrl &= ~PCIM_MSICTRL_MSI_ENABLE; 1929 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 1930 2); 1931 } 1932 1933 /* 1934 * Restore MSI registers during resume. If MSI is enabled then 1935 * restore the data and address registers in addition to the control 1936 * register. 1937 */ 1938 static void 1939 pci_resume_msi(device_t dev) 1940 { 1941 struct pci_devinfo *dinfo = device_get_ivars(dev); 1942 struct pcicfg_msi *msi = &dinfo->cfg.msi; 1943 uint64_t address; 1944 uint16_t data; 1945 1946 if (msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE) { 1947 address = msi->msi_addr; 1948 data = msi->msi_data; 1949 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR, 1950 address & 0xffffffff, 4); 1951 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 1952 pci_write_config(dev, msi->msi_location + 1953 PCIR_MSI_ADDR_HIGH, address >> 32, 4); 1954 pci_write_config(dev, msi->msi_location + 1955 PCIR_MSI_DATA_64BIT, data, 2); 1956 } else 1957 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA, 1958 data, 2); 1959 } 1960 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 1961 2); 1962 } 1963 1964 static int 1965 pci_remap_intr_method(device_t bus, device_t dev, u_int irq) 1966 { 1967 struct pci_devinfo *dinfo = device_get_ivars(dev); 1968 pcicfgregs *cfg = &dinfo->cfg; 1969 struct resource_list_entry *rle; 1970 struct msix_table_entry *mte; 1971 struct msix_vector *mv; 1972 uint64_t addr; 1973 uint32_t data; 1974 int error, i, j; 1975 1976 /* 1977 * Handle MSI first. We try to find this IRQ among our list 1978 * of MSI IRQs. If we find it, we request updated address and 1979 * data registers and apply the results. 1980 */ 1981 if (cfg->msi.msi_alloc > 0) { 1982 1983 /* If we don't have any active handlers, nothing to do. */ 1984 if (cfg->msi.msi_handlers == 0) 1985 return (0); 1986 for (i = 0; i < cfg->msi.msi_alloc; i++) { 1987 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 1988 i + 1); 1989 if (rle->start == irq) { 1990 error = PCIB_MAP_MSI(device_get_parent(bus), 1991 dev, irq, &addr, &data); 1992 if (error) 1993 return (error); 1994 pci_disable_msi(dev); 1995 dinfo->cfg.msi.msi_addr = addr; 1996 dinfo->cfg.msi.msi_data = data; 1997 pci_enable_msi(dev, addr, data); 1998 return (0); 1999 } 2000 } 2001 return (ENOENT); 2002 } 2003 2004 /* 2005 * For MSI-X, we check to see if we have this IRQ. If we do, 2006 * we request the updated mapping info. If that works, we go 2007 * through all the slots that use this IRQ and update them. 2008 */ 2009 if (cfg->msix.msix_alloc > 0) { 2010 for (i = 0; i < cfg->msix.msix_alloc; i++) { 2011 mv = &cfg->msix.msix_vectors[i]; 2012 if (mv->mv_irq == irq) { 2013 error = PCIB_MAP_MSI(device_get_parent(bus), 2014 dev, irq, &addr, &data); 2015 if (error) 2016 return (error); 2017 mv->mv_address = addr; 2018 mv->mv_data = data; 2019 for (j = 0; j < cfg->msix.msix_table_len; j++) { 2020 mte = &cfg->msix.msix_table[j]; 2021 if (mte->mte_vector != i + 1) 2022 continue; 2023 if (mte->mte_handlers == 0) 2024 continue; 2025 pci_mask_msix(dev, j); 2026 pci_enable_msix(dev, j, addr, data); 2027 pci_unmask_msix(dev, j); 2028 } 2029 } 2030 } 2031 return (ENOENT); 2032 } 2033 2034 return (ENOENT); 2035 } 2036 2037 /* 2038 * Returns true if the specified device is blacklisted because MSI 2039 * doesn't work. 2040 */ 2041 int 2042 pci_msi_device_blacklisted(device_t dev) 2043 { 2044 2045 if (!pci_honor_msi_blacklist) 2046 return (0); 2047 2048 return (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSI)); 2049 } 2050 2051 /* 2052 * Determine if MSI is blacklisted globally on this system. Currently, 2053 * we just check for blacklisted chipsets as represented by the 2054 * host-PCI bridge at device 0:0:0. In the future, it may become 2055 * necessary to check other system attributes, such as the kenv values 2056 * that give the motherboard manufacturer and model number. 2057 */ 2058 static int 2059 pci_msi_blacklisted(void) 2060 { 2061 device_t dev; 2062 2063 if (!pci_honor_msi_blacklist) 2064 return (0); 2065 2066 /* Blacklist all non-PCI-express and non-PCI-X chipsets. */ 2067 if (!(pcie_chipset || pcix_chipset)) { 2068 if (vm_guest != VM_GUEST_NO) { 2069 /* 2070 * Whitelist older chipsets in virtual 2071 * machines known to support MSI. 2072 */ 2073 dev = pci_find_bsf(0, 0, 0); 2074 if (dev != NULL) 2075 return (!pci_has_quirk(pci_get_devid(dev), 2076 PCI_QUIRK_ENABLE_MSI_VM)); 2077 } 2078 return (1); 2079 } 2080 2081 dev = pci_find_bsf(0, 0, 0); 2082 if (dev != NULL) 2083 return (pci_msi_device_blacklisted(dev)); 2084 return (0); 2085 } 2086 2087 /* 2088 * Returns true if the specified device is blacklisted because MSI-X 2089 * doesn't work. Note that this assumes that if MSI doesn't work, 2090 * MSI-X doesn't either. 2091 */ 2092 int 2093 pci_msix_device_blacklisted(device_t dev) 2094 { 2095 2096 if (!pci_honor_msi_blacklist) 2097 return (0); 2098 2099 if (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSIX)) 2100 return (1); 2101 2102 return (pci_msi_device_blacklisted(dev)); 2103 } 2104 2105 /* 2106 * Determine if MSI-X is blacklisted globally on this system. If MSI 2107 * is blacklisted, assume that MSI-X is as well. Check for additional 2108 * chipsets where MSI works but MSI-X does not. 2109 */ 2110 static int 2111 pci_msix_blacklisted(void) 2112 { 2113 device_t dev; 2114 2115 if (!pci_honor_msi_blacklist) 2116 return (0); 2117 2118 dev = pci_find_bsf(0, 0, 0); 2119 if (dev != NULL && pci_has_quirk(pci_get_devid(dev), 2120 PCI_QUIRK_DISABLE_MSIX)) 2121 return (1); 2122 2123 return (pci_msi_blacklisted()); 2124 } 2125 2126 /* 2127 * Attempt to allocate *count MSI messages. The actual number allocated is 2128 * returned in *count. After this function returns, each message will be 2129 * available to the driver as SYS_RES_IRQ resources starting at a rid 1. 2130 */ 2131 int 2132 pci_alloc_msi_method(device_t dev, device_t child, int *count) 2133 { 2134 struct pci_devinfo *dinfo = device_get_ivars(child); 2135 pcicfgregs *cfg = &dinfo->cfg; 2136 struct resource_list_entry *rle; 2137 int actual, error, i, irqs[32]; 2138 uint16_t ctrl; 2139 2140 /* Don't let count == 0 get us into trouble. */ 2141 if (*count == 0) 2142 return (EINVAL); 2143 2144 /* If rid 0 is allocated, then fail. */ 2145 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 2146 if (rle != NULL && rle->res != NULL) 2147 return (ENXIO); 2148 2149 /* Already have allocated messages? */ 2150 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 2151 return (ENXIO); 2152 2153 /* If MSI is blacklisted for this system, fail. */ 2154 if (pci_msi_blacklisted()) 2155 return (ENXIO); 2156 2157 /* MSI capability present? */ 2158 if (cfg->msi.msi_location == 0 || !pci_do_msi) 2159 return (ENODEV); 2160 2161 if (bootverbose) 2162 device_printf(child, 2163 "attempting to allocate %d MSI vectors (%d supported)\n", 2164 *count, cfg->msi.msi_msgnum); 2165 2166 /* Don't ask for more than the device supports. */ 2167 actual = min(*count, cfg->msi.msi_msgnum); 2168 2169 /* Don't ask for more than 32 messages. */ 2170 actual = min(actual, 32); 2171 2172 /* MSI requires power of 2 number of messages. */ 2173 if (!powerof2(actual)) 2174 return (EINVAL); 2175 2176 for (;;) { 2177 /* Try to allocate N messages. */ 2178 error = PCIB_ALLOC_MSI(device_get_parent(dev), child, actual, 2179 actual, irqs); 2180 if (error == 0) 2181 break; 2182 if (actual == 1) 2183 return (error); 2184 2185 /* Try N / 2. */ 2186 actual >>= 1; 2187 } 2188 2189 /* 2190 * We now have N actual messages mapped onto SYS_RES_IRQ 2191 * resources in the irqs[] array, so add new resources 2192 * starting at rid 1. 2193 */ 2194 for (i = 0; i < actual; i++) 2195 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, 2196 irqs[i], irqs[i], 1); 2197 2198 if (bootverbose) { 2199 if (actual == 1) 2200 device_printf(child, "using IRQ %d for MSI\n", irqs[0]); 2201 else { 2202 int run; 2203 2204 /* 2205 * Be fancy and try to print contiguous runs 2206 * of IRQ values as ranges. 'run' is true if 2207 * we are in a range. 2208 */ 2209 device_printf(child, "using IRQs %d", irqs[0]); 2210 run = 0; 2211 for (i = 1; i < actual; i++) { 2212 2213 /* Still in a run? */ 2214 if (irqs[i] == irqs[i - 1] + 1) { 2215 run = 1; 2216 continue; 2217 } 2218 2219 /* Finish previous range. */ 2220 if (run) { 2221 printf("-%d", irqs[i - 1]); 2222 run = 0; 2223 } 2224 2225 /* Start new range. */ 2226 printf(",%d", irqs[i]); 2227 } 2228 2229 /* Unfinished range? */ 2230 if (run) 2231 printf("-%d", irqs[actual - 1]); 2232 printf(" for MSI\n"); 2233 } 2234 } 2235 2236 /* Update control register with actual count. */ 2237 ctrl = cfg->msi.msi_ctrl; 2238 ctrl &= ~PCIM_MSICTRL_MME_MASK; 2239 ctrl |= (ffs(actual) - 1) << 4; 2240 cfg->msi.msi_ctrl = ctrl; 2241 pci_write_config(child, cfg->msi.msi_location + PCIR_MSI_CTRL, ctrl, 2); 2242 2243 /* Update counts of alloc'd messages. */ 2244 cfg->msi.msi_alloc = actual; 2245 cfg->msi.msi_handlers = 0; 2246 *count = actual; 2247 return (0); 2248 } 2249 2250 /* Release the MSI messages associated with this device. */ 2251 int 2252 pci_release_msi_method(device_t dev, device_t child) 2253 { 2254 struct pci_devinfo *dinfo = device_get_ivars(child); 2255 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2256 struct resource_list_entry *rle; 2257 int error, i, irqs[32]; 2258 2259 /* Try MSI-X first. */ 2260 error = pci_release_msix(dev, child); 2261 if (error != ENODEV) 2262 return (error); 2263 2264 /* Do we have any messages to release? */ 2265 if (msi->msi_alloc == 0) 2266 return (ENODEV); 2267 KASSERT(msi->msi_alloc <= 32, ("more than 32 alloc'd messages")); 2268 2269 /* Make sure none of the resources are allocated. */ 2270 if (msi->msi_handlers > 0) 2271 return (EBUSY); 2272 for (i = 0; i < msi->msi_alloc; i++) { 2273 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2274 KASSERT(rle != NULL, ("missing MSI resource")); 2275 if (rle->res != NULL) 2276 return (EBUSY); 2277 irqs[i] = rle->start; 2278 } 2279 2280 /* Update control register with 0 count. */ 2281 KASSERT(!(msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE), 2282 ("%s: MSI still enabled", __func__)); 2283 msi->msi_ctrl &= ~PCIM_MSICTRL_MME_MASK; 2284 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2285 msi->msi_ctrl, 2); 2286 2287 /* Release the messages. */ 2288 PCIB_RELEASE_MSI(device_get_parent(dev), child, msi->msi_alloc, irqs); 2289 for (i = 0; i < msi->msi_alloc; i++) 2290 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2291 2292 /* Update alloc count. */ 2293 msi->msi_alloc = 0; 2294 msi->msi_addr = 0; 2295 msi->msi_data = 0; 2296 return (0); 2297 } 2298 2299 /* 2300 * Return the max supported MSI messages this device supports. 2301 * Basically, assuming the MD code can alloc messages, this function 2302 * should return the maximum value that pci_alloc_msi() can return. 2303 * Thus, it is subject to the tunables, etc. 2304 */ 2305 int 2306 pci_msi_count_method(device_t dev, device_t child) 2307 { 2308 struct pci_devinfo *dinfo = device_get_ivars(child); 2309 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2310 2311 if (pci_do_msi && msi->msi_location != 0) 2312 return (msi->msi_msgnum); 2313 return (0); 2314 } 2315 2316 /* free pcicfgregs structure and all depending data structures */ 2317 2318 int 2319 pci_freecfg(struct pci_devinfo *dinfo) 2320 { 2321 struct devlist *devlist_head; 2322 struct pci_map *pm, *next; 2323 int i; 2324 2325 devlist_head = &pci_devq; 2326 2327 if (dinfo->cfg.vpd.vpd_reg) { 2328 free(dinfo->cfg.vpd.vpd_ident, M_DEVBUF); 2329 for (i = 0; i < dinfo->cfg.vpd.vpd_rocnt; i++) 2330 free(dinfo->cfg.vpd.vpd_ros[i].value, M_DEVBUF); 2331 free(dinfo->cfg.vpd.vpd_ros, M_DEVBUF); 2332 for (i = 0; i < dinfo->cfg.vpd.vpd_wcnt; i++) 2333 free(dinfo->cfg.vpd.vpd_w[i].value, M_DEVBUF); 2334 free(dinfo->cfg.vpd.vpd_w, M_DEVBUF); 2335 } 2336 STAILQ_FOREACH_SAFE(pm, &dinfo->cfg.maps, pm_link, next) { 2337 free(pm, M_DEVBUF); 2338 } 2339 STAILQ_REMOVE(devlist_head, dinfo, pci_devinfo, pci_links); 2340 free(dinfo, M_DEVBUF); 2341 2342 /* increment the generation count */ 2343 pci_generation++; 2344 2345 /* we're losing one device */ 2346 pci_numdevs--; 2347 return (0); 2348 } 2349 2350 /* 2351 * PCI power manangement 2352 */ 2353 int 2354 pci_set_powerstate_method(device_t dev, device_t child, int state) 2355 { 2356 struct pci_devinfo *dinfo = device_get_ivars(child); 2357 pcicfgregs *cfg = &dinfo->cfg; 2358 uint16_t status; 2359 int result, oldstate, highest, delay; 2360 2361 if (cfg->pp.pp_cap == 0) 2362 return (EOPNOTSUPP); 2363 2364 /* 2365 * Optimize a no state change request away. While it would be OK to 2366 * write to the hardware in theory, some devices have shown odd 2367 * behavior when going from D3 -> D3. 2368 */ 2369 oldstate = pci_get_powerstate(child); 2370 if (oldstate == state) 2371 return (0); 2372 2373 /* 2374 * The PCI power management specification states that after a state 2375 * transition between PCI power states, system software must 2376 * guarantee a minimal delay before the function accesses the device. 2377 * Compute the worst case delay that we need to guarantee before we 2378 * access the device. Many devices will be responsive much more 2379 * quickly than this delay, but there are some that don't respond 2380 * instantly to state changes. Transitions to/from D3 state require 2381 * 10ms, while D2 requires 200us, and D0/1 require none. The delay 2382 * is done below with DELAY rather than a sleeper function because 2383 * this function can be called from contexts where we cannot sleep. 2384 */ 2385 highest = (oldstate > state) ? oldstate : state; 2386 if (highest == PCI_POWERSTATE_D3) 2387 delay = 10000; 2388 else if (highest == PCI_POWERSTATE_D2) 2389 delay = 200; 2390 else 2391 delay = 0; 2392 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2) 2393 & ~PCIM_PSTAT_DMASK; 2394 result = 0; 2395 switch (state) { 2396 case PCI_POWERSTATE_D0: 2397 status |= PCIM_PSTAT_D0; 2398 break; 2399 case PCI_POWERSTATE_D1: 2400 if ((cfg->pp.pp_cap & PCIM_PCAP_D1SUPP) == 0) 2401 return (EOPNOTSUPP); 2402 status |= PCIM_PSTAT_D1; 2403 break; 2404 case PCI_POWERSTATE_D2: 2405 if ((cfg->pp.pp_cap & PCIM_PCAP_D2SUPP) == 0) 2406 return (EOPNOTSUPP); 2407 status |= PCIM_PSTAT_D2; 2408 break; 2409 case PCI_POWERSTATE_D3: 2410 status |= PCIM_PSTAT_D3; 2411 break; 2412 default: 2413 return (EINVAL); 2414 } 2415 2416 if (bootverbose) 2417 pci_printf(cfg, "Transition from D%d to D%d\n", oldstate, 2418 state); 2419 2420 PCI_WRITE_CONFIG(dev, child, cfg->pp.pp_status, status, 2); 2421 if (delay) 2422 DELAY(delay); 2423 return (0); 2424 } 2425 2426 int 2427 pci_get_powerstate_method(device_t dev, device_t child) 2428 { 2429 struct pci_devinfo *dinfo = device_get_ivars(child); 2430 pcicfgregs *cfg = &dinfo->cfg; 2431 uint16_t status; 2432 int result; 2433 2434 if (cfg->pp.pp_cap != 0) { 2435 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2); 2436 switch (status & PCIM_PSTAT_DMASK) { 2437 case PCIM_PSTAT_D0: 2438 result = PCI_POWERSTATE_D0; 2439 break; 2440 case PCIM_PSTAT_D1: 2441 result = PCI_POWERSTATE_D1; 2442 break; 2443 case PCIM_PSTAT_D2: 2444 result = PCI_POWERSTATE_D2; 2445 break; 2446 case PCIM_PSTAT_D3: 2447 result = PCI_POWERSTATE_D3; 2448 break; 2449 default: 2450 result = PCI_POWERSTATE_UNKNOWN; 2451 break; 2452 } 2453 } else { 2454 /* No support, device is always at D0 */ 2455 result = PCI_POWERSTATE_D0; 2456 } 2457 return (result); 2458 } 2459 2460 /* 2461 * Some convenience functions for PCI device drivers. 2462 */ 2463 2464 static __inline void 2465 pci_set_command_bit(device_t dev, device_t child, uint16_t bit) 2466 { 2467 uint16_t command; 2468 2469 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2470 command |= bit; 2471 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2472 } 2473 2474 static __inline void 2475 pci_clear_command_bit(device_t dev, device_t child, uint16_t bit) 2476 { 2477 uint16_t command; 2478 2479 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2480 command &= ~bit; 2481 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2482 } 2483 2484 int 2485 pci_enable_busmaster_method(device_t dev, device_t child) 2486 { 2487 pci_set_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2488 return (0); 2489 } 2490 2491 int 2492 pci_disable_busmaster_method(device_t dev, device_t child) 2493 { 2494 pci_clear_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2495 return (0); 2496 } 2497 2498 int 2499 pci_enable_io_method(device_t dev, device_t child, int space) 2500 { 2501 uint16_t bit; 2502 2503 switch(space) { 2504 case SYS_RES_IOPORT: 2505 bit = PCIM_CMD_PORTEN; 2506 break; 2507 case SYS_RES_MEMORY: 2508 bit = PCIM_CMD_MEMEN; 2509 break; 2510 default: 2511 return (EINVAL); 2512 } 2513 pci_set_command_bit(dev, child, bit); 2514 return (0); 2515 } 2516 2517 int 2518 pci_disable_io_method(device_t dev, device_t child, int space) 2519 { 2520 uint16_t bit; 2521 2522 switch(space) { 2523 case SYS_RES_IOPORT: 2524 bit = PCIM_CMD_PORTEN; 2525 break; 2526 case SYS_RES_MEMORY: 2527 bit = PCIM_CMD_MEMEN; 2528 break; 2529 default: 2530 return (EINVAL); 2531 } 2532 pci_clear_command_bit(dev, child, bit); 2533 return (0); 2534 } 2535 2536 /* 2537 * New style pci driver. Parent device is either a pci-host-bridge or a 2538 * pci-pci-bridge. Both kinds are represented by instances of pcib. 2539 */ 2540 2541 void 2542 pci_print_verbose(struct pci_devinfo *dinfo) 2543 { 2544 2545 if (bootverbose) { 2546 pcicfgregs *cfg = &dinfo->cfg; 2547 2548 printf("found->\tvendor=0x%04x, dev=0x%04x, revid=0x%02x\n", 2549 cfg->vendor, cfg->device, cfg->revid); 2550 printf("\tdomain=%d, bus=%d, slot=%d, func=%d\n", 2551 cfg->domain, cfg->bus, cfg->slot, cfg->func); 2552 printf("\tclass=%02x-%02x-%02x, hdrtype=0x%02x, mfdev=%d\n", 2553 cfg->baseclass, cfg->subclass, cfg->progif, cfg->hdrtype, 2554 cfg->mfdev); 2555 printf("\tcmdreg=0x%04x, statreg=0x%04x, cachelnsz=%d (dwords)\n", 2556 cfg->cmdreg, cfg->statreg, cfg->cachelnsz); 2557 printf("\tlattimer=0x%02x (%d ns), mingnt=0x%02x (%d ns), maxlat=0x%02x (%d ns)\n", 2558 cfg->lattimer, cfg->lattimer * 30, cfg->mingnt, 2559 cfg->mingnt * 250, cfg->maxlat, cfg->maxlat * 250); 2560 if (cfg->intpin > 0) 2561 printf("\tintpin=%c, irq=%d\n", 2562 cfg->intpin +'a' -1, cfg->intline); 2563 if (cfg->pp.pp_cap) { 2564 uint16_t status; 2565 2566 status = pci_read_config(cfg->dev, cfg->pp.pp_status, 2); 2567 printf("\tpowerspec %d supports D0%s%s D3 current D%d\n", 2568 cfg->pp.pp_cap & PCIM_PCAP_SPEC, 2569 cfg->pp.pp_cap & PCIM_PCAP_D1SUPP ? " D1" : "", 2570 cfg->pp.pp_cap & PCIM_PCAP_D2SUPP ? " D2" : "", 2571 status & PCIM_PSTAT_DMASK); 2572 } 2573 if (cfg->msi.msi_location) { 2574 int ctrl; 2575 2576 ctrl = cfg->msi.msi_ctrl; 2577 printf("\tMSI supports %d message%s%s%s\n", 2578 cfg->msi.msi_msgnum, 2579 (cfg->msi.msi_msgnum == 1) ? "" : "s", 2580 (ctrl & PCIM_MSICTRL_64BIT) ? ", 64 bit" : "", 2581 (ctrl & PCIM_MSICTRL_VECTOR) ? ", vector masks":""); 2582 } 2583 if (cfg->msix.msix_location) { 2584 printf("\tMSI-X supports %d message%s ", 2585 cfg->msix.msix_msgnum, 2586 (cfg->msix.msix_msgnum == 1) ? "" : "s"); 2587 if (cfg->msix.msix_table_bar == cfg->msix.msix_pba_bar) 2588 printf("in map 0x%x\n", 2589 cfg->msix.msix_table_bar); 2590 else 2591 printf("in maps 0x%x and 0x%x\n", 2592 cfg->msix.msix_table_bar, 2593 cfg->msix.msix_pba_bar); 2594 } 2595 } 2596 } 2597 2598 static int 2599 pci_porten(device_t dev) 2600 { 2601 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_PORTEN) != 0; 2602 } 2603 2604 static int 2605 pci_memen(device_t dev) 2606 { 2607 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_MEMEN) != 0; 2608 } 2609 2610 static void 2611 pci_read_bar(device_t dev, int reg, pci_addr_t *mapp, pci_addr_t *testvalp) 2612 { 2613 struct pci_devinfo *dinfo; 2614 pci_addr_t map, testval; 2615 int ln2range; 2616 uint16_t cmd; 2617 2618 /* 2619 * The device ROM BAR is special. It is always a 32-bit 2620 * memory BAR. Bit 0 is special and should not be set when 2621 * sizing the BAR. 2622 */ 2623 dinfo = device_get_ivars(dev); 2624 if (PCIR_IS_BIOS(&dinfo->cfg, reg)) { 2625 map = pci_read_config(dev, reg, 4); 2626 pci_write_config(dev, reg, 0xfffffffe, 4); 2627 testval = pci_read_config(dev, reg, 4); 2628 pci_write_config(dev, reg, map, 4); 2629 *mapp = map; 2630 *testvalp = testval; 2631 return; 2632 } 2633 2634 map = pci_read_config(dev, reg, 4); 2635 ln2range = pci_maprange(map); 2636 if (ln2range == 64) 2637 map |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 2638 2639 /* 2640 * Disable decoding via the command register before 2641 * determining the BAR's length since we will be placing it in 2642 * a weird state. 2643 */ 2644 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 2645 pci_write_config(dev, PCIR_COMMAND, 2646 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 2647 2648 /* 2649 * Determine the BAR's length by writing all 1's. The bottom 2650 * log_2(size) bits of the BAR will stick as 0 when we read 2651 * the value back. 2652 */ 2653 pci_write_config(dev, reg, 0xffffffff, 4); 2654 testval = pci_read_config(dev, reg, 4); 2655 if (ln2range == 64) { 2656 pci_write_config(dev, reg + 4, 0xffffffff, 4); 2657 testval |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 2658 } 2659 2660 /* 2661 * Restore the original value of the BAR. We may have reprogrammed 2662 * the BAR of the low-level console device and when booting verbose, 2663 * we need the console device addressable. 2664 */ 2665 pci_write_config(dev, reg, map, 4); 2666 if (ln2range == 64) 2667 pci_write_config(dev, reg + 4, map >> 32, 4); 2668 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 2669 2670 *mapp = map; 2671 *testvalp = testval; 2672 } 2673 2674 static void 2675 pci_write_bar(device_t dev, struct pci_map *pm, pci_addr_t base) 2676 { 2677 struct pci_devinfo *dinfo; 2678 int ln2range; 2679 2680 /* The device ROM BAR is always a 32-bit memory BAR. */ 2681 dinfo = device_get_ivars(dev); 2682 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 2683 ln2range = 32; 2684 else 2685 ln2range = pci_maprange(pm->pm_value); 2686 pci_write_config(dev, pm->pm_reg, base, 4); 2687 if (ln2range == 64) 2688 pci_write_config(dev, pm->pm_reg + 4, base >> 32, 4); 2689 pm->pm_value = pci_read_config(dev, pm->pm_reg, 4); 2690 if (ln2range == 64) 2691 pm->pm_value |= (pci_addr_t)pci_read_config(dev, 2692 pm->pm_reg + 4, 4) << 32; 2693 } 2694 2695 struct pci_map * 2696 pci_find_bar(device_t dev, int reg) 2697 { 2698 struct pci_devinfo *dinfo; 2699 struct pci_map *pm; 2700 2701 dinfo = device_get_ivars(dev); 2702 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 2703 if (pm->pm_reg == reg) 2704 return (pm); 2705 } 2706 return (NULL); 2707 } 2708 2709 int 2710 pci_bar_enabled(device_t dev, struct pci_map *pm) 2711 { 2712 struct pci_devinfo *dinfo; 2713 uint16_t cmd; 2714 2715 dinfo = device_get_ivars(dev); 2716 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) && 2717 !(pm->pm_value & PCIM_BIOS_ENABLE)) 2718 return (0); 2719 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 2720 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) || PCI_BAR_MEM(pm->pm_value)) 2721 return ((cmd & PCIM_CMD_MEMEN) != 0); 2722 else 2723 return ((cmd & PCIM_CMD_PORTEN) != 0); 2724 } 2725 2726 static struct pci_map * 2727 pci_add_bar(device_t dev, int reg, pci_addr_t value, pci_addr_t size) 2728 { 2729 struct pci_devinfo *dinfo; 2730 struct pci_map *pm, *prev; 2731 2732 dinfo = device_get_ivars(dev); 2733 pm = malloc(sizeof(*pm), M_DEVBUF, M_WAITOK | M_ZERO); 2734 pm->pm_reg = reg; 2735 pm->pm_value = value; 2736 pm->pm_size = size; 2737 STAILQ_FOREACH(prev, &dinfo->cfg.maps, pm_link) { 2738 KASSERT(prev->pm_reg != pm->pm_reg, ("duplicate map %02x", 2739 reg)); 2740 if (STAILQ_NEXT(prev, pm_link) == NULL || 2741 STAILQ_NEXT(prev, pm_link)->pm_reg > pm->pm_reg) 2742 break; 2743 } 2744 if (prev != NULL) 2745 STAILQ_INSERT_AFTER(&dinfo->cfg.maps, prev, pm, pm_link); 2746 else 2747 STAILQ_INSERT_TAIL(&dinfo->cfg.maps, pm, pm_link); 2748 return (pm); 2749 } 2750 2751 static void 2752 pci_restore_bars(device_t dev) 2753 { 2754 struct pci_devinfo *dinfo; 2755 struct pci_map *pm; 2756 int ln2range; 2757 2758 dinfo = device_get_ivars(dev); 2759 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 2760 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 2761 ln2range = 32; 2762 else 2763 ln2range = pci_maprange(pm->pm_value); 2764 pci_write_config(dev, pm->pm_reg, pm->pm_value, 4); 2765 if (ln2range == 64) 2766 pci_write_config(dev, pm->pm_reg + 4, 2767 pm->pm_value >> 32, 4); 2768 } 2769 } 2770 2771 /* 2772 * Add a resource based on a pci map register. Return 1 if the map 2773 * register is a 32bit map register or 2 if it is a 64bit register. 2774 */ 2775 static int 2776 pci_add_map(device_t bus, device_t dev, int reg, struct resource_list *rl, 2777 int force, int prefetch) 2778 { 2779 struct pci_map *pm; 2780 pci_addr_t base, map, testval; 2781 pci_addr_t start, end, count; 2782 int barlen, basezero, flags, maprange, mapsize, type; 2783 uint16_t cmd; 2784 struct resource *res; 2785 2786 /* 2787 * The BAR may already exist if the device is a CardBus card 2788 * whose CIS is stored in this BAR. 2789 */ 2790 pm = pci_find_bar(dev, reg); 2791 if (pm != NULL) { 2792 maprange = pci_maprange(pm->pm_value); 2793 barlen = maprange == 64 ? 2 : 1; 2794 return (barlen); 2795 } 2796 2797 pci_read_bar(dev, reg, &map, &testval); 2798 if (PCI_BAR_MEM(map)) { 2799 type = SYS_RES_MEMORY; 2800 if (map & PCIM_BAR_MEM_PREFETCH) 2801 prefetch = 1; 2802 } else 2803 type = SYS_RES_IOPORT; 2804 mapsize = pci_mapsize(testval); 2805 base = pci_mapbase(map); 2806 #ifdef __PCI_BAR_ZERO_VALID 2807 basezero = 0; 2808 #else 2809 basezero = base == 0; 2810 #endif 2811 maprange = pci_maprange(map); 2812 barlen = maprange == 64 ? 2 : 1; 2813 2814 /* 2815 * For I/O registers, if bottom bit is set, and the next bit up 2816 * isn't clear, we know we have a BAR that doesn't conform to the 2817 * spec, so ignore it. Also, sanity check the size of the data 2818 * areas to the type of memory involved. Memory must be at least 2819 * 16 bytes in size, while I/O ranges must be at least 4. 2820 */ 2821 if (PCI_BAR_IO(testval) && (testval & PCIM_BAR_IO_RESERVED) != 0) 2822 return (barlen); 2823 if ((type == SYS_RES_MEMORY && mapsize < 4) || 2824 (type == SYS_RES_IOPORT && mapsize < 2)) 2825 return (barlen); 2826 2827 /* Save a record of this BAR. */ 2828 pm = pci_add_bar(dev, reg, map, mapsize); 2829 if (bootverbose) { 2830 printf("\tmap[%02x]: type %s, range %2d, base %#jx, size %2d", 2831 reg, pci_maptype(map), maprange, (uintmax_t)base, mapsize); 2832 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 2833 printf(", port disabled\n"); 2834 else if (type == SYS_RES_MEMORY && !pci_memen(dev)) 2835 printf(", memory disabled\n"); 2836 else 2837 printf(", enabled\n"); 2838 } 2839 2840 /* 2841 * If base is 0, then we have problems if this architecture does 2842 * not allow that. It is best to ignore such entries for the 2843 * moment. These will be allocated later if the driver specifically 2844 * requests them. However, some removable busses look better when 2845 * all resources are allocated, so allow '' to be overriden. 2846 * 2847 * Similarly treat maps whose values is the same as the test value 2848 * read back. These maps have had all f's written to them by the 2849 * BIOS in an attempt to disable the resources. 2850 */ 2851 if (!force && (basezero || map == testval)) 2852 return (barlen); 2853 if ((u_long)base != base) { 2854 device_printf(bus, 2855 "pci%d:%d:%d:%d bar %#x too many address bits", 2856 pci_get_domain(dev), pci_get_bus(dev), pci_get_slot(dev), 2857 pci_get_function(dev), reg); 2858 return (barlen); 2859 } 2860 2861 /* 2862 * This code theoretically does the right thing, but has 2863 * undesirable side effects in some cases where peripherals 2864 * respond oddly to having these bits enabled. Let the user 2865 * be able to turn them off (since pci_enable_io_modes is 1 by 2866 * default). 2867 */ 2868 if (pci_enable_io_modes) { 2869 /* Turn on resources that have been left off by a lazy BIOS */ 2870 if (type == SYS_RES_IOPORT && !pci_porten(dev)) { 2871 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 2872 cmd |= PCIM_CMD_PORTEN; 2873 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 2874 } 2875 if (type == SYS_RES_MEMORY && !pci_memen(dev)) { 2876 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 2877 cmd |= PCIM_CMD_MEMEN; 2878 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 2879 } 2880 } else { 2881 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 2882 return (barlen); 2883 if (type == SYS_RES_MEMORY && !pci_memen(dev)) 2884 return (barlen); 2885 } 2886 2887 count = (pci_addr_t)1 << mapsize; 2888 flags = RF_ALIGNMENT_LOG2(mapsize); 2889 if (prefetch) 2890 flags |= RF_PREFETCHABLE; 2891 if (basezero || base == pci_mapbase(testval) || pci_clear_bars) { 2892 start = 0; /* Let the parent decide. */ 2893 end = ~0ul; 2894 } else { 2895 start = base; 2896 end = base + count - 1; 2897 } 2898 resource_list_add(rl, type, reg, start, end, count); 2899 2900 /* 2901 * Try to allocate the resource for this BAR from our parent 2902 * so that this resource range is already reserved. The 2903 * driver for this device will later inherit this resource in 2904 * pci_alloc_resource(). 2905 */ 2906 res = resource_list_reserve(rl, bus, dev, type, ®, start, end, count, 2907 flags); 2908 if (pci_do_realloc_bars && res == NULL && (start != 0 || end != ~0ul)) { 2909 /* 2910 * If the allocation fails, try to allocate a resource for 2911 * this BAR using any available range. The firmware felt 2912 * it was important enough to assign a resource, so don't 2913 * disable decoding if we can help it. 2914 */ 2915 resource_list_delete(rl, type, reg); 2916 resource_list_add(rl, type, reg, 0, ~0ul, count); 2917 res = resource_list_reserve(rl, bus, dev, type, ®, 0, ~0ul, 2918 count, flags); 2919 } 2920 if (res == NULL) { 2921 /* 2922 * If the allocation fails, delete the resource list entry 2923 * and disable decoding for this device. 2924 * 2925 * If the driver requests this resource in the future, 2926 * pci_reserve_map() will try to allocate a fresh 2927 * resource range. 2928 */ 2929 resource_list_delete(rl, type, reg); 2930 pci_disable_io(dev, type); 2931 if (bootverbose) 2932 device_printf(bus, 2933 "pci%d:%d:%d:%d bar %#x failed to allocate\n", 2934 pci_get_domain(dev), pci_get_bus(dev), 2935 pci_get_slot(dev), pci_get_function(dev), reg); 2936 } else { 2937 start = rman_get_start(res); 2938 pci_write_bar(dev, pm, start); 2939 } 2940 return (barlen); 2941 } 2942 2943 /* 2944 * For ATA devices we need to decide early what addressing mode to use. 2945 * Legacy demands that the primary and secondary ATA ports sits on the 2946 * same addresses that old ISA hardware did. This dictates that we use 2947 * those addresses and ignore the BAR's if we cannot set PCI native 2948 * addressing mode. 2949 */ 2950 static void 2951 pci_ata_maps(device_t bus, device_t dev, struct resource_list *rl, int force, 2952 uint32_t prefetchmask) 2953 { 2954 struct resource *r; 2955 int rid, type, progif; 2956 #if 0 2957 /* if this device supports PCI native addressing use it */ 2958 progif = pci_read_config(dev, PCIR_PROGIF, 1); 2959 if ((progif & 0x8a) == 0x8a) { 2960 if (pci_mapbase(pci_read_config(dev, PCIR_BAR(0), 4)) && 2961 pci_mapbase(pci_read_config(dev, PCIR_BAR(2), 4))) { 2962 printf("Trying ATA native PCI addressing mode\n"); 2963 pci_write_config(dev, PCIR_PROGIF, progif | 0x05, 1); 2964 } 2965 } 2966 #endif 2967 progif = pci_read_config(dev, PCIR_PROGIF, 1); 2968 type = SYS_RES_IOPORT; 2969 if (progif & PCIP_STORAGE_IDE_MODEPRIM) { 2970 pci_add_map(bus, dev, PCIR_BAR(0), rl, force, 2971 prefetchmask & (1 << 0)); 2972 pci_add_map(bus, dev, PCIR_BAR(1), rl, force, 2973 prefetchmask & (1 << 1)); 2974 } else { 2975 rid = PCIR_BAR(0); 2976 resource_list_add(rl, type, rid, 0x1f0, 0x1f7, 8); 2977 r = resource_list_reserve(rl, bus, dev, type, &rid, 0x1f0, 2978 0x1f7, 8, 0); 2979 rid = PCIR_BAR(1); 2980 resource_list_add(rl, type, rid, 0x3f6, 0x3f6, 1); 2981 r = resource_list_reserve(rl, bus, dev, type, &rid, 0x3f6, 2982 0x3f6, 1, 0); 2983 } 2984 if (progif & PCIP_STORAGE_IDE_MODESEC) { 2985 pci_add_map(bus, dev, PCIR_BAR(2), rl, force, 2986 prefetchmask & (1 << 2)); 2987 pci_add_map(bus, dev, PCIR_BAR(3), rl, force, 2988 prefetchmask & (1 << 3)); 2989 } else { 2990 rid = PCIR_BAR(2); 2991 resource_list_add(rl, type, rid, 0x170, 0x177, 8); 2992 r = resource_list_reserve(rl, bus, dev, type, &rid, 0x170, 2993 0x177, 8, 0); 2994 rid = PCIR_BAR(3); 2995 resource_list_add(rl, type, rid, 0x376, 0x376, 1); 2996 r = resource_list_reserve(rl, bus, dev, type, &rid, 0x376, 2997 0x376, 1, 0); 2998 } 2999 pci_add_map(bus, dev, PCIR_BAR(4), rl, force, 3000 prefetchmask & (1 << 4)); 3001 pci_add_map(bus, dev, PCIR_BAR(5), rl, force, 3002 prefetchmask & (1 << 5)); 3003 } 3004 3005 static void 3006 pci_assign_interrupt(device_t bus, device_t dev, int force_route) 3007 { 3008 struct pci_devinfo *dinfo = device_get_ivars(dev); 3009 pcicfgregs *cfg = &dinfo->cfg; 3010 char tunable_name[64]; 3011 int irq; 3012 3013 /* Has to have an intpin to have an interrupt. */ 3014 if (cfg->intpin == 0) 3015 return; 3016 3017 /* Let the user override the IRQ with a tunable. */ 3018 irq = PCI_INVALID_IRQ; 3019 snprintf(tunable_name, sizeof(tunable_name), 3020 "hw.pci%d.%d.%d.INT%c.irq", 3021 cfg->domain, cfg->bus, cfg->slot, cfg->intpin + 'A' - 1); 3022 if (TUNABLE_INT_FETCH(tunable_name, &irq) && (irq >= 255 || irq <= 0)) 3023 irq = PCI_INVALID_IRQ; 3024 3025 /* 3026 * If we didn't get an IRQ via the tunable, then we either use the 3027 * IRQ value in the intline register or we ask the bus to route an 3028 * interrupt for us. If force_route is true, then we only use the 3029 * value in the intline register if the bus was unable to assign an 3030 * IRQ. 3031 */ 3032 if (!PCI_INTERRUPT_VALID(irq)) { 3033 if (!PCI_INTERRUPT_VALID(cfg->intline) || force_route) 3034 irq = PCI_ASSIGN_INTERRUPT(bus, dev); 3035 if (!PCI_INTERRUPT_VALID(irq)) 3036 irq = cfg->intline; 3037 } 3038 3039 /* If after all that we don't have an IRQ, just bail. */ 3040 if (!PCI_INTERRUPT_VALID(irq)) 3041 return; 3042 3043 /* Update the config register if it changed. */ 3044 if (irq != cfg->intline) { 3045 cfg->intline = irq; 3046 pci_write_config(dev, PCIR_INTLINE, irq, 1); 3047 } 3048 3049 /* Add this IRQ as rid 0 interrupt resource. */ 3050 resource_list_add(&dinfo->resources, SYS_RES_IRQ, 0, irq, irq, 1); 3051 } 3052 3053 /* Perform early OHCI takeover from SMM. */ 3054 static void 3055 ohci_early_takeover(device_t self) 3056 { 3057 struct resource *res; 3058 uint32_t ctl; 3059 int rid; 3060 int i; 3061 3062 rid = PCIR_BAR(0); 3063 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3064 if (res == NULL) 3065 return; 3066 3067 ctl = bus_read_4(res, OHCI_CONTROL); 3068 if (ctl & OHCI_IR) { 3069 if (bootverbose) 3070 printf("ohci early: " 3071 "SMM active, request owner change\n"); 3072 bus_write_4(res, OHCI_COMMAND_STATUS, OHCI_OCR); 3073 for (i = 0; (i < 100) && (ctl & OHCI_IR); i++) { 3074 DELAY(1000); 3075 ctl = bus_read_4(res, OHCI_CONTROL); 3076 } 3077 if (ctl & OHCI_IR) { 3078 if (bootverbose) 3079 printf("ohci early: " 3080 "SMM does not respond, resetting\n"); 3081 bus_write_4(res, OHCI_CONTROL, OHCI_HCFS_RESET); 3082 } 3083 /* Disable interrupts */ 3084 bus_write_4(res, OHCI_INTERRUPT_DISABLE, OHCI_ALL_INTRS); 3085 } 3086 3087 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3088 } 3089 3090 /* Perform early UHCI takeover from SMM. */ 3091 static void 3092 uhci_early_takeover(device_t self) 3093 { 3094 struct resource *res; 3095 int rid; 3096 3097 /* 3098 * Set the PIRQD enable bit and switch off all the others. We don't 3099 * want legacy support to interfere with us XXX Does this also mean 3100 * that the BIOS won't touch the keyboard anymore if it is connected 3101 * to the ports of the root hub? 3102 */ 3103 pci_write_config(self, PCI_LEGSUP, PCI_LEGSUP_USBPIRQDEN, 2); 3104 3105 /* Disable interrupts */ 3106 rid = PCI_UHCI_BASE_REG; 3107 res = bus_alloc_resource_any(self, SYS_RES_IOPORT, &rid, RF_ACTIVE); 3108 if (res != NULL) { 3109 bus_write_2(res, UHCI_INTR, 0); 3110 bus_release_resource(self, SYS_RES_IOPORT, rid, res); 3111 } 3112 } 3113 3114 /* Perform early EHCI takeover from SMM. */ 3115 static void 3116 ehci_early_takeover(device_t self) 3117 { 3118 struct resource *res; 3119 uint32_t cparams; 3120 uint32_t eec; 3121 uint8_t eecp; 3122 uint8_t bios_sem; 3123 uint8_t offs; 3124 int rid; 3125 int i; 3126 3127 rid = PCIR_BAR(0); 3128 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3129 if (res == NULL) 3130 return; 3131 3132 cparams = bus_read_4(res, EHCI_HCCPARAMS); 3133 3134 /* Synchronise with the BIOS if it owns the controller. */ 3135 for (eecp = EHCI_HCC_EECP(cparams); eecp != 0; 3136 eecp = EHCI_EECP_NEXT(eec)) { 3137 eec = pci_read_config(self, eecp, 4); 3138 if (EHCI_EECP_ID(eec) != EHCI_EC_LEGSUP) { 3139 continue; 3140 } 3141 bios_sem = pci_read_config(self, eecp + 3142 EHCI_LEGSUP_BIOS_SEM, 1); 3143 if (bios_sem == 0) { 3144 continue; 3145 } 3146 if (bootverbose) 3147 printf("ehci early: " 3148 "SMM active, request owner change\n"); 3149 3150 pci_write_config(self, eecp + EHCI_LEGSUP_OS_SEM, 1, 1); 3151 3152 for (i = 0; (i < 100) && (bios_sem != 0); i++) { 3153 DELAY(1000); 3154 bios_sem = pci_read_config(self, eecp + 3155 EHCI_LEGSUP_BIOS_SEM, 1); 3156 } 3157 3158 if (bios_sem != 0) { 3159 if (bootverbose) 3160 printf("ehci early: " 3161 "SMM does not respond\n"); 3162 } 3163 /* Disable interrupts */ 3164 offs = EHCI_CAPLENGTH(bus_read_4(res, EHCI_CAPLEN_HCIVERSION)); 3165 bus_write_4(res, offs + EHCI_USBINTR, 0); 3166 } 3167 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3168 } 3169 3170 /* Perform early XHCI takeover from SMM. */ 3171 static void 3172 xhci_early_takeover(device_t self) 3173 { 3174 struct resource *res; 3175 uint32_t cparams; 3176 uint32_t eec; 3177 uint8_t eecp; 3178 uint8_t bios_sem; 3179 uint8_t offs; 3180 int rid; 3181 int i; 3182 3183 rid = PCIR_BAR(0); 3184 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3185 if (res == NULL) 3186 return; 3187 3188 cparams = bus_read_4(res, XHCI_HCSPARAMS0); 3189 3190 eec = -1; 3191 3192 /* Synchronise with the BIOS if it owns the controller. */ 3193 for (eecp = XHCI_HCS0_XECP(cparams) << 2; eecp != 0 && XHCI_XECP_NEXT(eec); 3194 eecp += XHCI_XECP_NEXT(eec) << 2) { 3195 eec = bus_read_4(res, eecp); 3196 3197 if (XHCI_XECP_ID(eec) != XHCI_ID_USB_LEGACY) 3198 continue; 3199 3200 bios_sem = bus_read_1(res, eecp + XHCI_XECP_BIOS_SEM); 3201 if (bios_sem == 0) 3202 continue; 3203 3204 if (bootverbose) 3205 printf("xhci early: " 3206 "SMM active, request owner change\n"); 3207 3208 bus_write_1(res, eecp + XHCI_XECP_OS_SEM, 1); 3209 3210 /* wait a maximum of 5 second */ 3211 3212 for (i = 0; (i < 5000) && (bios_sem != 0); i++) { 3213 DELAY(1000); 3214 bios_sem = bus_read_1(res, eecp + 3215 XHCI_XECP_BIOS_SEM); 3216 } 3217 3218 if (bios_sem != 0) { 3219 if (bootverbose) 3220 printf("xhci early: " 3221 "SMM does not respond\n"); 3222 } 3223 3224 /* Disable interrupts */ 3225 offs = bus_read_1(res, XHCI_CAPLENGTH); 3226 bus_write_4(res, offs + XHCI_USBCMD, 0); 3227 bus_read_4(res, offs + XHCI_USBSTS); 3228 } 3229 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3230 } 3231 3232 void 3233 pci_add_resources(device_t bus, device_t dev, int force, uint32_t prefetchmask) 3234 { 3235 struct pci_devinfo *dinfo; 3236 pcicfgregs *cfg; 3237 struct resource_list *rl; 3238 const struct pci_quirk *q; 3239 uint32_t devid; 3240 int i; 3241 3242 dinfo = device_get_ivars(dev); 3243 cfg = &dinfo->cfg; 3244 rl = &dinfo->resources; 3245 devid = (cfg->device << 16) | cfg->vendor; 3246 3247 /* ATA devices needs special map treatment */ 3248 if ((pci_get_class(dev) == PCIC_STORAGE) && 3249 (pci_get_subclass(dev) == PCIS_STORAGE_IDE) && 3250 ((pci_get_progif(dev) & PCIP_STORAGE_IDE_MASTERDEV) || 3251 (!pci_read_config(dev, PCIR_BAR(0), 4) && 3252 !pci_read_config(dev, PCIR_BAR(2), 4))) ) 3253 pci_ata_maps(bus, dev, rl, force, prefetchmask); 3254 else 3255 for (i = 0; i < cfg->nummaps;) { 3256 /* 3257 * Skip quirked resources. 3258 */ 3259 for (q = &pci_quirks[0]; q->devid != 0; q++) 3260 if (q->devid == devid && 3261 q->type == PCI_QUIRK_UNMAP_REG && 3262 q->arg1 == PCIR_BAR(i)) 3263 break; 3264 if (q->devid != 0) { 3265 i++; 3266 continue; 3267 } 3268 i += pci_add_map(bus, dev, PCIR_BAR(i), rl, force, 3269 prefetchmask & (1 << i)); 3270 } 3271 3272 /* 3273 * Add additional, quirked resources. 3274 */ 3275 for (q = &pci_quirks[0]; q->devid != 0; q++) 3276 if (q->devid == devid && q->type == PCI_QUIRK_MAP_REG) 3277 pci_add_map(bus, dev, q->arg1, rl, force, 0); 3278 3279 if (cfg->intpin > 0 && PCI_INTERRUPT_VALID(cfg->intline)) { 3280 #ifdef __PCI_REROUTE_INTERRUPT 3281 /* 3282 * Try to re-route interrupts. Sometimes the BIOS or 3283 * firmware may leave bogus values in these registers. 3284 * If the re-route fails, then just stick with what we 3285 * have. 3286 */ 3287 pci_assign_interrupt(bus, dev, 1); 3288 #else 3289 pci_assign_interrupt(bus, dev, 0); 3290 #endif 3291 } 3292 3293 if (pci_usb_takeover && pci_get_class(dev) == PCIC_SERIALBUS && 3294 pci_get_subclass(dev) == PCIS_SERIALBUS_USB) { 3295 if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_XHCI) 3296 xhci_early_takeover(dev); 3297 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_EHCI) 3298 ehci_early_takeover(dev); 3299 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_OHCI) 3300 ohci_early_takeover(dev); 3301 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_UHCI) 3302 uhci_early_takeover(dev); 3303 } 3304 } 3305 3306 void 3307 pci_add_children(device_t dev, int domain, int busno, size_t dinfo_size) 3308 { 3309 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 3310 device_t pcib = device_get_parent(dev); 3311 struct pci_devinfo *dinfo; 3312 int maxslots; 3313 int s, f, pcifunchigh; 3314 uint8_t hdrtype; 3315 3316 KASSERT(dinfo_size >= sizeof(struct pci_devinfo), 3317 ("dinfo_size too small")); 3318 maxslots = PCIB_MAXSLOTS(pcib); 3319 for (s = 0; s <= maxslots; s++) { 3320 pcifunchigh = 0; 3321 f = 0; 3322 DELAY(1); 3323 hdrtype = REG(PCIR_HDRTYPE, 1); 3324 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 3325 continue; 3326 if (hdrtype & PCIM_MFDEV) 3327 pcifunchigh = PCI_FUNCMAX; 3328 for (f = 0; f <= pcifunchigh; f++) { 3329 dinfo = pci_read_device(pcib, domain, busno, s, f, 3330 dinfo_size); 3331 if (dinfo != NULL) { 3332 pci_add_child(dev, dinfo); 3333 } 3334 } 3335 } 3336 #undef REG 3337 } 3338 3339 void 3340 pci_add_child(device_t bus, struct pci_devinfo *dinfo) 3341 { 3342 dinfo->cfg.dev = device_add_child(bus, NULL, -1); 3343 device_set_ivars(dinfo->cfg.dev, dinfo); 3344 resource_list_init(&dinfo->resources); 3345 pci_cfg_save(dinfo->cfg.dev, dinfo, 0); 3346 pci_cfg_restore(dinfo->cfg.dev, dinfo); 3347 pci_print_verbose(dinfo); 3348 pci_add_resources(bus, dinfo->cfg.dev, 0, 0); 3349 } 3350 3351 static int 3352 pci_probe(device_t dev) 3353 { 3354 3355 device_set_desc(dev, "PCI bus"); 3356 3357 /* Allow other subclasses to override this driver. */ 3358 return (BUS_PROBE_GENERIC); 3359 } 3360 3361 int 3362 pci_attach_common(device_t dev) 3363 { 3364 struct pci_softc *sc; 3365 int busno, domain; 3366 #ifdef PCI_DMA_BOUNDARY 3367 int error, tag_valid; 3368 #endif 3369 3370 sc = device_get_softc(dev); 3371 domain = pcib_get_domain(dev); 3372 busno = pcib_get_bus(dev); 3373 if (bootverbose) 3374 device_printf(dev, "domain=%d, physical bus=%d\n", 3375 domain, busno); 3376 #ifdef PCI_DMA_BOUNDARY 3377 tag_valid = 0; 3378 if (device_get_devclass(device_get_parent(device_get_parent(dev))) != 3379 devclass_find("pci")) { 3380 error = bus_dma_tag_create(bus_get_dma_tag(dev), 1, 3381 PCI_DMA_BOUNDARY, BUS_SPACE_MAXADDR, BUS_SPACE_MAXADDR, 3382 NULL, NULL, BUS_SPACE_MAXSIZE, BUS_SPACE_UNRESTRICTED, 3383 BUS_SPACE_MAXSIZE, 0, NULL, NULL, &sc->sc_dma_tag); 3384 if (error) 3385 device_printf(dev, "Failed to create DMA tag: %d\n", 3386 error); 3387 else 3388 tag_valid = 1; 3389 } 3390 if (!tag_valid) 3391 #endif 3392 sc->sc_dma_tag = bus_get_dma_tag(dev); 3393 return (0); 3394 } 3395 3396 static int 3397 pci_attach(device_t dev) 3398 { 3399 int busno, domain, error; 3400 3401 error = pci_attach_common(dev); 3402 if (error) 3403 return (error); 3404 3405 /* 3406 * Since there can be multiple independantly numbered PCI 3407 * busses on systems with multiple PCI domains, we can't use 3408 * the unit number to decide which bus we are probing. We ask 3409 * the parent pcib what our domain and bus numbers are. 3410 */ 3411 domain = pcib_get_domain(dev); 3412 busno = pcib_get_bus(dev); 3413 pci_add_children(dev, domain, busno, sizeof(struct pci_devinfo)); 3414 return (bus_generic_attach(dev)); 3415 } 3416 3417 static void 3418 pci_set_power_children(device_t dev, device_t *devlist, int numdevs, 3419 int state) 3420 { 3421 device_t child, pcib; 3422 struct pci_devinfo *dinfo; 3423 int dstate, i; 3424 3425 /* 3426 * Set the device to the given state. If the firmware suggests 3427 * a different power state, use it instead. If power management 3428 * is not present, the firmware is responsible for managing 3429 * device power. Skip children who aren't attached since they 3430 * are handled separately. 3431 */ 3432 pcib = device_get_parent(dev); 3433 for (i = 0; i < numdevs; i++) { 3434 child = devlist[i]; 3435 dinfo = device_get_ivars(child); 3436 dstate = state; 3437 if (device_is_attached(child) && 3438 PCIB_POWER_FOR_SLEEP(pcib, dev, &dstate) == 0) 3439 pci_set_powerstate(child, dstate); 3440 } 3441 } 3442 3443 int 3444 pci_suspend(device_t dev) 3445 { 3446 device_t child, *devlist; 3447 struct pci_devinfo *dinfo; 3448 int error, i, numdevs; 3449 3450 /* 3451 * Save the PCI configuration space for each child and set the 3452 * device in the appropriate power state for this sleep state. 3453 */ 3454 if ((error = device_get_children(dev, &devlist, &numdevs)) != 0) 3455 return (error); 3456 for (i = 0; i < numdevs; i++) { 3457 child = devlist[i]; 3458 dinfo = device_get_ivars(child); 3459 pci_cfg_save(child, dinfo, 0); 3460 } 3461 3462 /* Suspend devices before potentially powering them down. */ 3463 error = bus_generic_suspend(dev); 3464 if (error) { 3465 free(devlist, M_TEMP); 3466 return (error); 3467 } 3468 if (pci_do_power_suspend) 3469 pci_set_power_children(dev, devlist, numdevs, 3470 PCI_POWERSTATE_D3); 3471 free(devlist, M_TEMP); 3472 return (0); 3473 } 3474 3475 int 3476 pci_resume(device_t dev) 3477 { 3478 device_t child, *devlist; 3479 struct pci_devinfo *dinfo; 3480 int error, i, numdevs; 3481 3482 /* 3483 * Set each child to D0 and restore its PCI configuration space. 3484 */ 3485 if ((error = device_get_children(dev, &devlist, &numdevs)) != 0) 3486 return (error); 3487 if (pci_do_power_resume) 3488 pci_set_power_children(dev, devlist, numdevs, 3489 PCI_POWERSTATE_D0); 3490 3491 /* Now the device is powered up, restore its config space. */ 3492 for (i = 0; i < numdevs; i++) { 3493 child = devlist[i]; 3494 dinfo = device_get_ivars(child); 3495 3496 pci_cfg_restore(child, dinfo); 3497 if (!device_is_attached(child)) 3498 pci_cfg_save(child, dinfo, 1); 3499 } 3500 3501 /* 3502 * Resume critical devices first, then everything else later. 3503 */ 3504 for (i = 0; i < numdevs; i++) { 3505 child = devlist[i]; 3506 switch (pci_get_class(child)) { 3507 case PCIC_DISPLAY: 3508 case PCIC_MEMORY: 3509 case PCIC_BRIDGE: 3510 case PCIC_BASEPERIPH: 3511 DEVICE_RESUME(child); 3512 break; 3513 } 3514 } 3515 for (i = 0; i < numdevs; i++) { 3516 child = devlist[i]; 3517 switch (pci_get_class(child)) { 3518 case PCIC_DISPLAY: 3519 case PCIC_MEMORY: 3520 case PCIC_BRIDGE: 3521 case PCIC_BASEPERIPH: 3522 break; 3523 default: 3524 DEVICE_RESUME(child); 3525 } 3526 } 3527 free(devlist, M_TEMP); 3528 return (0); 3529 } 3530 3531 static void 3532 pci_load_vendor_data(void) 3533 { 3534 caddr_t data; 3535 void *ptr; 3536 size_t sz; 3537 3538 data = preload_search_by_type("pci_vendor_data"); 3539 if (data != NULL) { 3540 ptr = preload_fetch_addr(data); 3541 sz = preload_fetch_size(data); 3542 if (ptr != NULL && sz != 0) { 3543 pci_vendordata = ptr; 3544 pci_vendordata_size = sz; 3545 /* terminate the database */ 3546 pci_vendordata[pci_vendordata_size] = '\n'; 3547 } 3548 } 3549 } 3550 3551 void 3552 pci_driver_added(device_t dev, driver_t *driver) 3553 { 3554 int numdevs; 3555 device_t *devlist; 3556 device_t child; 3557 struct pci_devinfo *dinfo; 3558 int i; 3559 3560 if (bootverbose) 3561 device_printf(dev, "driver added\n"); 3562 DEVICE_IDENTIFY(driver, dev); 3563 if (device_get_children(dev, &devlist, &numdevs) != 0) 3564 return; 3565 for (i = 0; i < numdevs; i++) { 3566 child = devlist[i]; 3567 if (device_get_state(child) != DS_NOTPRESENT) 3568 continue; 3569 dinfo = device_get_ivars(child); 3570 pci_print_verbose(dinfo); 3571 if (bootverbose) 3572 pci_printf(&dinfo->cfg, "reprobing on driver added\n"); 3573 pci_cfg_restore(child, dinfo); 3574 if (device_probe_and_attach(child) != 0) 3575 pci_cfg_save(child, dinfo, 1); 3576 } 3577 free(devlist, M_TEMP); 3578 } 3579 3580 int 3581 pci_setup_intr(device_t dev, device_t child, struct resource *irq, int flags, 3582 driver_filter_t *filter, driver_intr_t *intr, void *arg, void **cookiep) 3583 { 3584 struct pci_devinfo *dinfo; 3585 struct msix_table_entry *mte; 3586 struct msix_vector *mv; 3587 uint64_t addr; 3588 uint32_t data; 3589 void *cookie; 3590 int error, rid; 3591 3592 error = bus_generic_setup_intr(dev, child, irq, flags, filter, intr, 3593 arg, &cookie); 3594 if (error) 3595 return (error); 3596 3597 /* If this is not a direct child, just bail out. */ 3598 if (device_get_parent(child) != dev) { 3599 *cookiep = cookie; 3600 return(0); 3601 } 3602 3603 rid = rman_get_rid(irq); 3604 if (rid == 0) { 3605 /* Make sure that INTx is enabled */ 3606 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 3607 } else { 3608 /* 3609 * Check to see if the interrupt is MSI or MSI-X. 3610 * Ask our parent to map the MSI and give 3611 * us the address and data register values. 3612 * If we fail for some reason, teardown the 3613 * interrupt handler. 3614 */ 3615 dinfo = device_get_ivars(child); 3616 if (dinfo->cfg.msi.msi_alloc > 0) { 3617 if (dinfo->cfg.msi.msi_addr == 0) { 3618 KASSERT(dinfo->cfg.msi.msi_handlers == 0, 3619 ("MSI has handlers, but vectors not mapped")); 3620 error = PCIB_MAP_MSI(device_get_parent(dev), 3621 child, rman_get_start(irq), &addr, &data); 3622 if (error) 3623 goto bad; 3624 dinfo->cfg.msi.msi_addr = addr; 3625 dinfo->cfg.msi.msi_data = data; 3626 } 3627 if (dinfo->cfg.msi.msi_handlers == 0) 3628 pci_enable_msi(child, dinfo->cfg.msi.msi_addr, 3629 dinfo->cfg.msi.msi_data); 3630 dinfo->cfg.msi.msi_handlers++; 3631 } else { 3632 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 3633 ("No MSI or MSI-X interrupts allocated")); 3634 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 3635 ("MSI-X index too high")); 3636 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 3637 KASSERT(mte->mte_vector != 0, ("no message vector")); 3638 mv = &dinfo->cfg.msix.msix_vectors[mte->mte_vector - 1]; 3639 KASSERT(mv->mv_irq == rman_get_start(irq), 3640 ("IRQ mismatch")); 3641 if (mv->mv_address == 0) { 3642 KASSERT(mte->mte_handlers == 0, 3643 ("MSI-X table entry has handlers, but vector not mapped")); 3644 error = PCIB_MAP_MSI(device_get_parent(dev), 3645 child, rman_get_start(irq), &addr, &data); 3646 if (error) 3647 goto bad; 3648 mv->mv_address = addr; 3649 mv->mv_data = data; 3650 } 3651 if (mte->mte_handlers == 0) { 3652 pci_enable_msix(child, rid - 1, mv->mv_address, 3653 mv->mv_data); 3654 pci_unmask_msix(child, rid - 1); 3655 } 3656 mte->mte_handlers++; 3657 } 3658 3659 /* 3660 * Make sure that INTx is disabled if we are using MSI/MSI-X, 3661 * unless the device is affected by PCI_QUIRK_MSI_INTX_BUG, 3662 * in which case we "enable" INTx so MSI/MSI-X actually works. 3663 */ 3664 if (!pci_has_quirk(pci_get_devid(child), 3665 PCI_QUIRK_MSI_INTX_BUG)) 3666 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 3667 else 3668 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 3669 bad: 3670 if (error) { 3671 (void)bus_generic_teardown_intr(dev, child, irq, 3672 cookie); 3673 return (error); 3674 } 3675 } 3676 *cookiep = cookie; 3677 return (0); 3678 } 3679 3680 int 3681 pci_teardown_intr(device_t dev, device_t child, struct resource *irq, 3682 void *cookie) 3683 { 3684 struct msix_table_entry *mte; 3685 struct resource_list_entry *rle; 3686 struct pci_devinfo *dinfo; 3687 int error, rid; 3688 3689 if (irq == NULL || !(rman_get_flags(irq) & RF_ACTIVE)) 3690 return (EINVAL); 3691 3692 /* If this isn't a direct child, just bail out */ 3693 if (device_get_parent(child) != dev) 3694 return(bus_generic_teardown_intr(dev, child, irq, cookie)); 3695 3696 rid = rman_get_rid(irq); 3697 if (rid == 0) { 3698 /* Mask INTx */ 3699 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 3700 } else { 3701 /* 3702 * Check to see if the interrupt is MSI or MSI-X. If so, 3703 * decrement the appropriate handlers count and mask the 3704 * MSI-X message, or disable MSI messages if the count 3705 * drops to 0. 3706 */ 3707 dinfo = device_get_ivars(child); 3708 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, rid); 3709 if (rle->res != irq) 3710 return (EINVAL); 3711 if (dinfo->cfg.msi.msi_alloc > 0) { 3712 KASSERT(rid <= dinfo->cfg.msi.msi_alloc, 3713 ("MSI-X index too high")); 3714 if (dinfo->cfg.msi.msi_handlers == 0) 3715 return (EINVAL); 3716 dinfo->cfg.msi.msi_handlers--; 3717 if (dinfo->cfg.msi.msi_handlers == 0) 3718 pci_disable_msi(child); 3719 } else { 3720 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 3721 ("No MSI or MSI-X interrupts allocated")); 3722 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 3723 ("MSI-X index too high")); 3724 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 3725 if (mte->mte_handlers == 0) 3726 return (EINVAL); 3727 mte->mte_handlers--; 3728 if (mte->mte_handlers == 0) 3729 pci_mask_msix(child, rid - 1); 3730 } 3731 } 3732 error = bus_generic_teardown_intr(dev, child, irq, cookie); 3733 if (rid > 0) 3734 KASSERT(error == 0, 3735 ("%s: generic teardown failed for MSI/MSI-X", __func__)); 3736 return (error); 3737 } 3738 3739 int 3740 pci_print_child(device_t dev, device_t child) 3741 { 3742 struct pci_devinfo *dinfo; 3743 struct resource_list *rl; 3744 int retval = 0; 3745 3746 dinfo = device_get_ivars(child); 3747 rl = &dinfo->resources; 3748 3749 retval += bus_print_child_header(dev, child); 3750 3751 retval += resource_list_print_type(rl, "port", SYS_RES_IOPORT, "%#lx"); 3752 retval += resource_list_print_type(rl, "mem", SYS_RES_MEMORY, "%#lx"); 3753 retval += resource_list_print_type(rl, "irq", SYS_RES_IRQ, "%ld"); 3754 if (device_get_flags(dev)) 3755 retval += printf(" flags %#x", device_get_flags(dev)); 3756 3757 retval += printf(" at device %d.%d", pci_get_slot(child), 3758 pci_get_function(child)); 3759 3760 retval += bus_print_child_footer(dev, child); 3761 3762 return (retval); 3763 } 3764 3765 static const struct 3766 { 3767 int class; 3768 int subclass; 3769 int report; /* 0 = bootverbose, 1 = always */ 3770 const char *desc; 3771 } pci_nomatch_tab[] = { 3772 {PCIC_OLD, -1, 1, "old"}, 3773 {PCIC_OLD, PCIS_OLD_NONVGA, 1, "non-VGA display device"}, 3774 {PCIC_OLD, PCIS_OLD_VGA, 1, "VGA-compatible display device"}, 3775 {PCIC_STORAGE, -1, 1, "mass storage"}, 3776 {PCIC_STORAGE, PCIS_STORAGE_SCSI, 1, "SCSI"}, 3777 {PCIC_STORAGE, PCIS_STORAGE_IDE, 1, "ATA"}, 3778 {PCIC_STORAGE, PCIS_STORAGE_FLOPPY, 1, "floppy disk"}, 3779 {PCIC_STORAGE, PCIS_STORAGE_IPI, 1, "IPI"}, 3780 {PCIC_STORAGE, PCIS_STORAGE_RAID, 1, "RAID"}, 3781 {PCIC_STORAGE, PCIS_STORAGE_ATA_ADMA, 1, "ATA (ADMA)"}, 3782 {PCIC_STORAGE, PCIS_STORAGE_SATA, 1, "SATA"}, 3783 {PCIC_STORAGE, PCIS_STORAGE_SAS, 1, "SAS"}, 3784 {PCIC_STORAGE, PCIS_STORAGE_NVM, 1, "NVM"}, 3785 {PCIC_NETWORK, -1, 1, "network"}, 3786 {PCIC_NETWORK, PCIS_NETWORK_ETHERNET, 1, "ethernet"}, 3787 {PCIC_NETWORK, PCIS_NETWORK_TOKENRING, 1, "token ring"}, 3788 {PCIC_NETWORK, PCIS_NETWORK_FDDI, 1, "fddi"}, 3789 {PCIC_NETWORK, PCIS_NETWORK_ATM, 1, "ATM"}, 3790 {PCIC_NETWORK, PCIS_NETWORK_ISDN, 1, "ISDN"}, 3791 {PCIC_DISPLAY, -1, 1, "display"}, 3792 {PCIC_DISPLAY, PCIS_DISPLAY_VGA, 1, "VGA"}, 3793 {PCIC_DISPLAY, PCIS_DISPLAY_XGA, 1, "XGA"}, 3794 {PCIC_DISPLAY, PCIS_DISPLAY_3D, 1, "3D"}, 3795 {PCIC_MULTIMEDIA, -1, 1, "multimedia"}, 3796 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_VIDEO, 1, "video"}, 3797 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_AUDIO, 1, "audio"}, 3798 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_TELE, 1, "telephony"}, 3799 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_HDA, 1, "HDA"}, 3800 {PCIC_MEMORY, -1, 1, "memory"}, 3801 {PCIC_MEMORY, PCIS_MEMORY_RAM, 1, "RAM"}, 3802 {PCIC_MEMORY, PCIS_MEMORY_FLASH, 1, "flash"}, 3803 {PCIC_BRIDGE, -1, 1, "bridge"}, 3804 {PCIC_BRIDGE, PCIS_BRIDGE_HOST, 1, "HOST-PCI"}, 3805 {PCIC_BRIDGE, PCIS_BRIDGE_ISA, 1, "PCI-ISA"}, 3806 {PCIC_BRIDGE, PCIS_BRIDGE_EISA, 1, "PCI-EISA"}, 3807 {PCIC_BRIDGE, PCIS_BRIDGE_MCA, 1, "PCI-MCA"}, 3808 {PCIC_BRIDGE, PCIS_BRIDGE_PCI, 1, "PCI-PCI"}, 3809 {PCIC_BRIDGE, PCIS_BRIDGE_PCMCIA, 1, "PCI-PCMCIA"}, 3810 {PCIC_BRIDGE, PCIS_BRIDGE_NUBUS, 1, "PCI-NuBus"}, 3811 {PCIC_BRIDGE, PCIS_BRIDGE_CARDBUS, 1, "PCI-CardBus"}, 3812 {PCIC_BRIDGE, PCIS_BRIDGE_RACEWAY, 1, "PCI-RACEway"}, 3813 {PCIC_SIMPLECOMM, -1, 1, "simple comms"}, 3814 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_UART, 1, "UART"}, /* could detect 16550 */ 3815 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_PAR, 1, "parallel port"}, 3816 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MULSER, 1, "multiport serial"}, 3817 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MODEM, 1, "generic modem"}, 3818 {PCIC_BASEPERIPH, -1, 0, "base peripheral"}, 3819 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PIC, 1, "interrupt controller"}, 3820 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_DMA, 1, "DMA controller"}, 3821 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_TIMER, 1, "timer"}, 3822 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_RTC, 1, "realtime clock"}, 3823 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PCIHOT, 1, "PCI hot-plug controller"}, 3824 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_SDHC, 1, "SD host controller"}, 3825 {PCIC_INPUTDEV, -1, 1, "input device"}, 3826 {PCIC_INPUTDEV, PCIS_INPUTDEV_KEYBOARD, 1, "keyboard"}, 3827 {PCIC_INPUTDEV, PCIS_INPUTDEV_DIGITIZER,1, "digitizer"}, 3828 {PCIC_INPUTDEV, PCIS_INPUTDEV_MOUSE, 1, "mouse"}, 3829 {PCIC_INPUTDEV, PCIS_INPUTDEV_SCANNER, 1, "scanner"}, 3830 {PCIC_INPUTDEV, PCIS_INPUTDEV_GAMEPORT, 1, "gameport"}, 3831 {PCIC_DOCKING, -1, 1, "docking station"}, 3832 {PCIC_PROCESSOR, -1, 1, "processor"}, 3833 {PCIC_SERIALBUS, -1, 1, "serial bus"}, 3834 {PCIC_SERIALBUS, PCIS_SERIALBUS_FW, 1, "FireWire"}, 3835 {PCIC_SERIALBUS, PCIS_SERIALBUS_ACCESS, 1, "AccessBus"}, 3836 {PCIC_SERIALBUS, PCIS_SERIALBUS_SSA, 1, "SSA"}, 3837 {PCIC_SERIALBUS, PCIS_SERIALBUS_USB, 1, "USB"}, 3838 {PCIC_SERIALBUS, PCIS_SERIALBUS_FC, 1, "Fibre Channel"}, 3839 {PCIC_SERIALBUS, PCIS_SERIALBUS_SMBUS, 0, "SMBus"}, 3840 {PCIC_WIRELESS, -1, 1, "wireless controller"}, 3841 {PCIC_WIRELESS, PCIS_WIRELESS_IRDA, 1, "iRDA"}, 3842 {PCIC_WIRELESS, PCIS_WIRELESS_IR, 1, "IR"}, 3843 {PCIC_WIRELESS, PCIS_WIRELESS_RF, 1, "RF"}, 3844 {PCIC_INTELLIIO, -1, 1, "intelligent I/O controller"}, 3845 {PCIC_INTELLIIO, PCIS_INTELLIIO_I2O, 1, "I2O"}, 3846 {PCIC_SATCOM, -1, 1, "satellite communication"}, 3847 {PCIC_SATCOM, PCIS_SATCOM_TV, 1, "sat TV"}, 3848 {PCIC_SATCOM, PCIS_SATCOM_AUDIO, 1, "sat audio"}, 3849 {PCIC_SATCOM, PCIS_SATCOM_VOICE, 1, "sat voice"}, 3850 {PCIC_SATCOM, PCIS_SATCOM_DATA, 1, "sat data"}, 3851 {PCIC_CRYPTO, -1, 1, "encrypt/decrypt"}, 3852 {PCIC_CRYPTO, PCIS_CRYPTO_NETCOMP, 1, "network/computer crypto"}, 3853 {PCIC_CRYPTO, PCIS_CRYPTO_ENTERTAIN, 1, "entertainment crypto"}, 3854 {PCIC_DASP, -1, 0, "dasp"}, 3855 {PCIC_DASP, PCIS_DASP_DPIO, 1, "DPIO module"}, 3856 {0, 0, 0, NULL} 3857 }; 3858 3859 void 3860 pci_probe_nomatch(device_t dev, device_t child) 3861 { 3862 int i, report; 3863 const char *cp, *scp; 3864 char *device; 3865 3866 /* 3867 * Look for a listing for this device in a loaded device database. 3868 */ 3869 report = 1; 3870 if ((device = pci_describe_device(child)) != NULL) { 3871 device_printf(dev, "<%s>", device); 3872 free(device, M_DEVBUF); 3873 } else { 3874 /* 3875 * Scan the class/subclass descriptions for a general 3876 * description. 3877 */ 3878 cp = "unknown"; 3879 scp = NULL; 3880 for (i = 0; pci_nomatch_tab[i].desc != NULL; i++) { 3881 if (pci_nomatch_tab[i].class == pci_get_class(child)) { 3882 if (pci_nomatch_tab[i].subclass == -1) { 3883 cp = pci_nomatch_tab[i].desc; 3884 report = pci_nomatch_tab[i].report; 3885 } else if (pci_nomatch_tab[i].subclass == 3886 pci_get_subclass(child)) { 3887 scp = pci_nomatch_tab[i].desc; 3888 report = pci_nomatch_tab[i].report; 3889 } 3890 } 3891 } 3892 if (report || bootverbose) { 3893 device_printf(dev, "<%s%s%s>", 3894 cp ? cp : "", 3895 ((cp != NULL) && (scp != NULL)) ? ", " : "", 3896 scp ? scp : ""); 3897 } 3898 } 3899 if (report || bootverbose) { 3900 printf(" at device %d.%d (no driver attached)\n", 3901 pci_get_slot(child), pci_get_function(child)); 3902 } 3903 pci_cfg_save(child, device_get_ivars(child), 1); 3904 } 3905 3906 /* 3907 * Parse the PCI device database, if loaded, and return a pointer to a 3908 * description of the device. 3909 * 3910 * The database is flat text formatted as follows: 3911 * 3912 * Any line not in a valid format is ignored. 3913 * Lines are terminated with newline '\n' characters. 3914 * 3915 * A VENDOR line consists of the 4 digit (hex) vendor code, a TAB, then 3916 * the vendor name. 3917 * 3918 * A DEVICE line is entered immediately below the corresponding VENDOR ID. 3919 * - devices cannot be listed without a corresponding VENDOR line. 3920 * A DEVICE line consists of a TAB, the 4 digit (hex) device code, 3921 * another TAB, then the device name. 3922 */ 3923 3924 /* 3925 * Assuming (ptr) points to the beginning of a line in the database, 3926 * return the vendor or device and description of the next entry. 3927 * The value of (vendor) or (device) inappropriate for the entry type 3928 * is set to -1. Returns nonzero at the end of the database. 3929 * 3930 * Note that this is slightly unrobust in the face of corrupt data; 3931 * we attempt to safeguard against this by spamming the end of the 3932 * database with a newline when we initialise. 3933 */ 3934 static int 3935 pci_describe_parse_line(char **ptr, int *vendor, int *device, char **desc) 3936 { 3937 char *cp = *ptr; 3938 int left; 3939 3940 *device = -1; 3941 *vendor = -1; 3942 **desc = '\0'; 3943 for (;;) { 3944 left = pci_vendordata_size - (cp - pci_vendordata); 3945 if (left <= 0) { 3946 *ptr = cp; 3947 return(1); 3948 } 3949 3950 /* vendor entry? */ 3951 if (*cp != '\t' && 3952 sscanf(cp, "%x\t%80[^\n]", vendor, *desc) == 2) 3953 break; 3954 /* device entry? */ 3955 if (*cp == '\t' && 3956 sscanf(cp, "%x\t%80[^\n]", device, *desc) == 2) 3957 break; 3958 3959 /* skip to next line */ 3960 while (*cp != '\n' && left > 0) { 3961 cp++; 3962 left--; 3963 } 3964 if (*cp == '\n') { 3965 cp++; 3966 left--; 3967 } 3968 } 3969 /* skip to next line */ 3970 while (*cp != '\n' && left > 0) { 3971 cp++; 3972 left--; 3973 } 3974 if (*cp == '\n' && left > 0) 3975 cp++; 3976 *ptr = cp; 3977 return(0); 3978 } 3979 3980 static char * 3981 pci_describe_device(device_t dev) 3982 { 3983 int vendor, device; 3984 char *desc, *vp, *dp, *line; 3985 3986 desc = vp = dp = NULL; 3987 3988 /* 3989 * If we have no vendor data, we can't do anything. 3990 */ 3991 if (pci_vendordata == NULL) 3992 goto out; 3993 3994 /* 3995 * Scan the vendor data looking for this device 3996 */ 3997 line = pci_vendordata; 3998 if ((vp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 3999 goto out; 4000 for (;;) { 4001 if (pci_describe_parse_line(&line, &vendor, &device, &vp)) 4002 goto out; 4003 if (vendor == pci_get_vendor(dev)) 4004 break; 4005 } 4006 if ((dp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 4007 goto out; 4008 for (;;) { 4009 if (pci_describe_parse_line(&line, &vendor, &device, &dp)) { 4010 *dp = 0; 4011 break; 4012 } 4013 if (vendor != -1) { 4014 *dp = 0; 4015 break; 4016 } 4017 if (device == pci_get_device(dev)) 4018 break; 4019 } 4020 if (dp[0] == '\0') 4021 snprintf(dp, 80, "0x%x", pci_get_device(dev)); 4022 if ((desc = malloc(strlen(vp) + strlen(dp) + 3, M_DEVBUF, M_NOWAIT)) != 4023 NULL) 4024 sprintf(desc, "%s, %s", vp, dp); 4025 out: 4026 if (vp != NULL) 4027 free(vp, M_DEVBUF); 4028 if (dp != NULL) 4029 free(dp, M_DEVBUF); 4030 return(desc); 4031 } 4032 4033 int 4034 pci_read_ivar(device_t dev, device_t child, int which, uintptr_t *result) 4035 { 4036 struct pci_devinfo *dinfo; 4037 pcicfgregs *cfg; 4038 4039 dinfo = device_get_ivars(child); 4040 cfg = &dinfo->cfg; 4041 4042 switch (which) { 4043 case PCI_IVAR_ETHADDR: 4044 /* 4045 * The generic accessor doesn't deal with failure, so 4046 * we set the return value, then return an error. 4047 */ 4048 *((uint8_t **) result) = NULL; 4049 return (EINVAL); 4050 case PCI_IVAR_SUBVENDOR: 4051 *result = cfg->subvendor; 4052 break; 4053 case PCI_IVAR_SUBDEVICE: 4054 *result = cfg->subdevice; 4055 break; 4056 case PCI_IVAR_VENDOR: 4057 *result = cfg->vendor; 4058 break; 4059 case PCI_IVAR_DEVICE: 4060 *result = cfg->device; 4061 break; 4062 case PCI_IVAR_DEVID: 4063 *result = (cfg->device << 16) | cfg->vendor; 4064 break; 4065 case PCI_IVAR_CLASS: 4066 *result = cfg->baseclass; 4067 break; 4068 case PCI_IVAR_SUBCLASS: 4069 *result = cfg->subclass; 4070 break; 4071 case PCI_IVAR_PROGIF: 4072 *result = cfg->progif; 4073 break; 4074 case PCI_IVAR_REVID: 4075 *result = cfg->revid; 4076 break; 4077 case PCI_IVAR_INTPIN: 4078 *result = cfg->intpin; 4079 break; 4080 case PCI_IVAR_IRQ: 4081 *result = cfg->intline; 4082 break; 4083 case PCI_IVAR_DOMAIN: 4084 *result = cfg->domain; 4085 break; 4086 case PCI_IVAR_BUS: 4087 *result = cfg->bus; 4088 break; 4089 case PCI_IVAR_SLOT: 4090 *result = cfg->slot; 4091 break; 4092 case PCI_IVAR_FUNCTION: 4093 *result = cfg->func; 4094 break; 4095 case PCI_IVAR_CMDREG: 4096 *result = cfg->cmdreg; 4097 break; 4098 case PCI_IVAR_CACHELNSZ: 4099 *result = cfg->cachelnsz; 4100 break; 4101 case PCI_IVAR_MINGNT: 4102 *result = cfg->mingnt; 4103 break; 4104 case PCI_IVAR_MAXLAT: 4105 *result = cfg->maxlat; 4106 break; 4107 case PCI_IVAR_LATTIMER: 4108 *result = cfg->lattimer; 4109 break; 4110 default: 4111 return (ENOENT); 4112 } 4113 return (0); 4114 } 4115 4116 int 4117 pci_write_ivar(device_t dev, device_t child, int which, uintptr_t value) 4118 { 4119 struct pci_devinfo *dinfo; 4120 4121 dinfo = device_get_ivars(child); 4122 4123 switch (which) { 4124 case PCI_IVAR_INTPIN: 4125 dinfo->cfg.intpin = value; 4126 return (0); 4127 case PCI_IVAR_ETHADDR: 4128 case PCI_IVAR_SUBVENDOR: 4129 case PCI_IVAR_SUBDEVICE: 4130 case PCI_IVAR_VENDOR: 4131 case PCI_IVAR_DEVICE: 4132 case PCI_IVAR_DEVID: 4133 case PCI_IVAR_CLASS: 4134 case PCI_IVAR_SUBCLASS: 4135 case PCI_IVAR_PROGIF: 4136 case PCI_IVAR_REVID: 4137 case PCI_IVAR_IRQ: 4138 case PCI_IVAR_DOMAIN: 4139 case PCI_IVAR_BUS: 4140 case PCI_IVAR_SLOT: 4141 case PCI_IVAR_FUNCTION: 4142 return (EINVAL); /* disallow for now */ 4143 4144 default: 4145 return (ENOENT); 4146 } 4147 } 4148 4149 #include "opt_ddb.h" 4150 #ifdef DDB 4151 #include <ddb/ddb.h> 4152 #include <sys/cons.h> 4153 4154 /* 4155 * List resources based on pci map registers, used for within ddb 4156 */ 4157 4158 DB_SHOW_COMMAND(pciregs, db_pci_dump) 4159 { 4160 struct pci_devinfo *dinfo; 4161 struct devlist *devlist_head; 4162 struct pci_conf *p; 4163 const char *name; 4164 int i, error, none_count; 4165 4166 none_count = 0; 4167 /* get the head of the device queue */ 4168 devlist_head = &pci_devq; 4169 4170 /* 4171 * Go through the list of devices and print out devices 4172 */ 4173 for (error = 0, i = 0, 4174 dinfo = STAILQ_FIRST(devlist_head); 4175 (dinfo != NULL) && (error == 0) && (i < pci_numdevs) && !db_pager_quit; 4176 dinfo = STAILQ_NEXT(dinfo, pci_links), i++) { 4177 4178 /* Populate pd_name and pd_unit */ 4179 name = NULL; 4180 if (dinfo->cfg.dev) 4181 name = device_get_name(dinfo->cfg.dev); 4182 4183 p = &dinfo->conf; 4184 db_printf("%s%d@pci%d:%d:%d:%d:\tclass=0x%06x card=0x%08x " 4185 "chip=0x%08x rev=0x%02x hdr=0x%02x\n", 4186 (name && *name) ? name : "none", 4187 (name && *name) ? (int)device_get_unit(dinfo->cfg.dev) : 4188 none_count++, 4189 p->pc_sel.pc_domain, p->pc_sel.pc_bus, p->pc_sel.pc_dev, 4190 p->pc_sel.pc_func, (p->pc_class << 16) | 4191 (p->pc_subclass << 8) | p->pc_progif, 4192 (p->pc_subdevice << 16) | p->pc_subvendor, 4193 (p->pc_device << 16) | p->pc_vendor, 4194 p->pc_revid, p->pc_hdr); 4195 } 4196 } 4197 #endif /* DDB */ 4198 4199 static struct resource * 4200 pci_reserve_map(device_t dev, device_t child, int type, int *rid, 4201 u_long start, u_long end, u_long count, u_int flags) 4202 { 4203 struct pci_devinfo *dinfo = device_get_ivars(child); 4204 struct resource_list *rl = &dinfo->resources; 4205 struct resource *res; 4206 struct pci_map *pm; 4207 pci_addr_t map, testval; 4208 int mapsize; 4209 4210 res = NULL; 4211 pm = pci_find_bar(child, *rid); 4212 if (pm != NULL) { 4213 /* This is a BAR that we failed to allocate earlier. */ 4214 mapsize = pm->pm_size; 4215 map = pm->pm_value; 4216 } else { 4217 /* 4218 * Weed out the bogons, and figure out how large the 4219 * BAR/map is. BARs that read back 0 here are bogus 4220 * and unimplemented. Note: atapci in legacy mode are 4221 * special and handled elsewhere in the code. If you 4222 * have a atapci device in legacy mode and it fails 4223 * here, that other code is broken. 4224 */ 4225 pci_read_bar(child, *rid, &map, &testval); 4226 4227 /* 4228 * Determine the size of the BAR and ignore BARs with a size 4229 * of 0. Device ROM BARs use a different mask value. 4230 */ 4231 if (PCIR_IS_BIOS(&dinfo->cfg, *rid)) 4232 mapsize = pci_romsize(testval); 4233 else 4234 mapsize = pci_mapsize(testval); 4235 if (mapsize == 0) 4236 goto out; 4237 pm = pci_add_bar(child, *rid, map, mapsize); 4238 } 4239 4240 if (PCI_BAR_MEM(map) || PCIR_IS_BIOS(&dinfo->cfg, *rid)) { 4241 if (type != SYS_RES_MEMORY) { 4242 if (bootverbose) 4243 device_printf(dev, 4244 "child %s requested type %d for rid %#x," 4245 " but the BAR says it is an memio\n", 4246 device_get_nameunit(child), type, *rid); 4247 goto out; 4248 } 4249 } else { 4250 if (type != SYS_RES_IOPORT) { 4251 if (bootverbose) 4252 device_printf(dev, 4253 "child %s requested type %d for rid %#x," 4254 " but the BAR says it is an ioport\n", 4255 device_get_nameunit(child), type, *rid); 4256 goto out; 4257 } 4258 } 4259 4260 /* 4261 * For real BARs, we need to override the size that 4262 * the driver requests, because that's what the BAR 4263 * actually uses and we would otherwise have a 4264 * situation where we might allocate the excess to 4265 * another driver, which won't work. 4266 */ 4267 count = (pci_addr_t)1 << mapsize; 4268 if (RF_ALIGNMENT(flags) < mapsize) 4269 flags = (flags & ~RF_ALIGNMENT_MASK) | RF_ALIGNMENT_LOG2(mapsize); 4270 if (PCI_BAR_MEM(map) && (map & PCIM_BAR_MEM_PREFETCH)) 4271 flags |= RF_PREFETCHABLE; 4272 4273 /* 4274 * Allocate enough resource, and then write back the 4275 * appropriate BAR for that resource. 4276 */ 4277 resource_list_add(rl, type, *rid, start, end, count); 4278 res = resource_list_reserve(rl, dev, child, type, rid, start, end, 4279 count, flags & ~RF_ACTIVE); 4280 if (res == NULL) { 4281 resource_list_delete(rl, type, *rid); 4282 device_printf(child, 4283 "%#lx bytes of rid %#x res %d failed (%#lx, %#lx).\n", 4284 count, *rid, type, start, end); 4285 goto out; 4286 } 4287 if (bootverbose) 4288 device_printf(child, 4289 "Lazy allocation of %#lx bytes rid %#x type %d at %#lx\n", 4290 count, *rid, type, rman_get_start(res)); 4291 map = rman_get_start(res); 4292 pci_write_bar(child, pm, map); 4293 out: 4294 return (res); 4295 } 4296 4297 struct resource * 4298 pci_alloc_resource(device_t dev, device_t child, int type, int *rid, 4299 u_long start, u_long end, u_long count, u_int flags) 4300 { 4301 struct pci_devinfo *dinfo; 4302 struct resource_list *rl; 4303 struct resource_list_entry *rle; 4304 struct resource *res; 4305 pcicfgregs *cfg; 4306 4307 if (device_get_parent(child) != dev) 4308 return (BUS_ALLOC_RESOURCE(device_get_parent(dev), child, 4309 type, rid, start, end, count, flags)); 4310 4311 /* 4312 * Perform lazy resource allocation 4313 */ 4314 dinfo = device_get_ivars(child); 4315 rl = &dinfo->resources; 4316 cfg = &dinfo->cfg; 4317 switch (type) { 4318 case SYS_RES_IRQ: 4319 /* 4320 * Can't alloc legacy interrupt once MSI messages have 4321 * been allocated. 4322 */ 4323 if (*rid == 0 && (cfg->msi.msi_alloc > 0 || 4324 cfg->msix.msix_alloc > 0)) 4325 return (NULL); 4326 4327 /* 4328 * If the child device doesn't have an interrupt 4329 * routed and is deserving of an interrupt, try to 4330 * assign it one. 4331 */ 4332 if (*rid == 0 && !PCI_INTERRUPT_VALID(cfg->intline) && 4333 (cfg->intpin != 0)) 4334 pci_assign_interrupt(dev, child, 0); 4335 break; 4336 case SYS_RES_IOPORT: 4337 case SYS_RES_MEMORY: 4338 #ifdef NEW_PCIB 4339 /* 4340 * PCI-PCI bridge I/O window resources are not BARs. 4341 * For those allocations just pass the request up the 4342 * tree. 4343 */ 4344 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE) { 4345 switch (*rid) { 4346 case PCIR_IOBASEL_1: 4347 case PCIR_MEMBASE_1: 4348 case PCIR_PMBASEL_1: 4349 /* 4350 * XXX: Should we bother creating a resource 4351 * list entry? 4352 */ 4353 return (bus_generic_alloc_resource(dev, child, 4354 type, rid, start, end, count, flags)); 4355 } 4356 } 4357 #endif 4358 /* Reserve resources for this BAR if needed. */ 4359 rle = resource_list_find(rl, type, *rid); 4360 if (rle == NULL) { 4361 res = pci_reserve_map(dev, child, type, rid, start, end, 4362 count, flags); 4363 if (res == NULL) 4364 return (NULL); 4365 } 4366 } 4367 return (resource_list_alloc(rl, dev, child, type, rid, 4368 start, end, count, flags)); 4369 } 4370 4371 int 4372 pci_release_resource(device_t dev, device_t child, int type, int rid, 4373 struct resource *r) 4374 { 4375 struct pci_devinfo *dinfo; 4376 struct resource_list *rl; 4377 pcicfgregs *cfg; 4378 4379 if (device_get_parent(child) != dev) 4380 return (BUS_RELEASE_RESOURCE(device_get_parent(dev), child, 4381 type, rid, r)); 4382 4383 dinfo = device_get_ivars(child); 4384 cfg = &dinfo->cfg; 4385 #ifdef NEW_PCIB 4386 /* 4387 * PCI-PCI bridge I/O window resources are not BARs. For 4388 * those allocations just pass the request up the tree. 4389 */ 4390 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE && 4391 (type == SYS_RES_IOPORT || type == SYS_RES_MEMORY)) { 4392 switch (rid) { 4393 case PCIR_IOBASEL_1: 4394 case PCIR_MEMBASE_1: 4395 case PCIR_PMBASEL_1: 4396 return (bus_generic_release_resource(dev, child, type, 4397 rid, r)); 4398 } 4399 } 4400 #endif 4401 4402 rl = &dinfo->resources; 4403 return (resource_list_release(rl, dev, child, type, rid, r)); 4404 } 4405 4406 int 4407 pci_activate_resource(device_t dev, device_t child, int type, int rid, 4408 struct resource *r) 4409 { 4410 struct pci_devinfo *dinfo; 4411 int error; 4412 4413 error = bus_generic_activate_resource(dev, child, type, rid, r); 4414 if (error) 4415 return (error); 4416 4417 /* Enable decoding in the command register when activating BARs. */ 4418 if (device_get_parent(child) == dev) { 4419 /* Device ROMs need their decoding explicitly enabled. */ 4420 dinfo = device_get_ivars(child); 4421 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 4422 pci_write_bar(child, pci_find_bar(child, rid), 4423 rman_get_start(r) | PCIM_BIOS_ENABLE); 4424 switch (type) { 4425 case SYS_RES_IOPORT: 4426 case SYS_RES_MEMORY: 4427 error = PCI_ENABLE_IO(dev, child, type); 4428 break; 4429 } 4430 } 4431 return (error); 4432 } 4433 4434 int 4435 pci_deactivate_resource(device_t dev, device_t child, int type, 4436 int rid, struct resource *r) 4437 { 4438 struct pci_devinfo *dinfo; 4439 int error; 4440 4441 error = bus_generic_deactivate_resource(dev, child, type, rid, r); 4442 if (error) 4443 return (error); 4444 4445 /* Disable decoding for device ROMs. */ 4446 if (device_get_parent(child) == dev) { 4447 dinfo = device_get_ivars(child); 4448 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 4449 pci_write_bar(child, pci_find_bar(child, rid), 4450 rman_get_start(r)); 4451 } 4452 return (0); 4453 } 4454 4455 void 4456 pci_delete_child(device_t dev, device_t child) 4457 { 4458 struct resource_list_entry *rle; 4459 struct resource_list *rl; 4460 struct pci_devinfo *dinfo; 4461 4462 dinfo = device_get_ivars(child); 4463 rl = &dinfo->resources; 4464 4465 if (device_is_attached(child)) 4466 device_detach(child); 4467 4468 /* Turn off access to resources we're about to free */ 4469 pci_write_config(child, PCIR_COMMAND, pci_read_config(child, 4470 PCIR_COMMAND, 2) & ~(PCIM_CMD_MEMEN | PCIM_CMD_PORTEN), 2); 4471 4472 /* Free all allocated resources */ 4473 STAILQ_FOREACH(rle, rl, link) { 4474 if (rle->res) { 4475 if (rman_get_flags(rle->res) & RF_ACTIVE || 4476 resource_list_busy(rl, rle->type, rle->rid)) { 4477 pci_printf(&dinfo->cfg, 4478 "Resource still owned, oops. " 4479 "(type=%d, rid=%d, addr=%lx)\n", 4480 rle->type, rle->rid, 4481 rman_get_start(rle->res)); 4482 bus_release_resource(child, rle->type, rle->rid, 4483 rle->res); 4484 } 4485 resource_list_unreserve(rl, dev, child, rle->type, 4486 rle->rid); 4487 } 4488 } 4489 resource_list_free(rl); 4490 4491 device_delete_child(dev, child); 4492 pci_freecfg(dinfo); 4493 } 4494 4495 void 4496 pci_delete_resource(device_t dev, device_t child, int type, int rid) 4497 { 4498 struct pci_devinfo *dinfo; 4499 struct resource_list *rl; 4500 struct resource_list_entry *rle; 4501 4502 if (device_get_parent(child) != dev) 4503 return; 4504 4505 dinfo = device_get_ivars(child); 4506 rl = &dinfo->resources; 4507 rle = resource_list_find(rl, type, rid); 4508 if (rle == NULL) 4509 return; 4510 4511 if (rle->res) { 4512 if (rman_get_flags(rle->res) & RF_ACTIVE || 4513 resource_list_busy(rl, type, rid)) { 4514 device_printf(dev, "delete_resource: " 4515 "Resource still owned by child, oops. " 4516 "(type=%d, rid=%d, addr=%lx)\n", 4517 type, rid, rman_get_start(rle->res)); 4518 return; 4519 } 4520 resource_list_unreserve(rl, dev, child, type, rid); 4521 } 4522 resource_list_delete(rl, type, rid); 4523 } 4524 4525 struct resource_list * 4526 pci_get_resource_list (device_t dev, device_t child) 4527 { 4528 struct pci_devinfo *dinfo = device_get_ivars(child); 4529 4530 return (&dinfo->resources); 4531 } 4532 4533 bus_dma_tag_t 4534 pci_get_dma_tag(device_t bus, device_t dev) 4535 { 4536 struct pci_softc *sc = device_get_softc(bus); 4537 4538 return (sc->sc_dma_tag); 4539 } 4540 4541 uint32_t 4542 pci_read_config_method(device_t dev, device_t child, int reg, int width) 4543 { 4544 struct pci_devinfo *dinfo = device_get_ivars(child); 4545 pcicfgregs *cfg = &dinfo->cfg; 4546 4547 return (PCIB_READ_CONFIG(device_get_parent(dev), 4548 cfg->bus, cfg->slot, cfg->func, reg, width)); 4549 } 4550 4551 void 4552 pci_write_config_method(device_t dev, device_t child, int reg, 4553 uint32_t val, int width) 4554 { 4555 struct pci_devinfo *dinfo = device_get_ivars(child); 4556 pcicfgregs *cfg = &dinfo->cfg; 4557 4558 PCIB_WRITE_CONFIG(device_get_parent(dev), 4559 cfg->bus, cfg->slot, cfg->func, reg, val, width); 4560 } 4561 4562 int 4563 pci_child_location_str_method(device_t dev, device_t child, char *buf, 4564 size_t buflen) 4565 { 4566 4567 snprintf(buf, buflen, "slot=%d function=%d", pci_get_slot(child), 4568 pci_get_function(child)); 4569 return (0); 4570 } 4571 4572 int 4573 pci_child_pnpinfo_str_method(device_t dev, device_t child, char *buf, 4574 size_t buflen) 4575 { 4576 struct pci_devinfo *dinfo; 4577 pcicfgregs *cfg; 4578 4579 dinfo = device_get_ivars(child); 4580 cfg = &dinfo->cfg; 4581 snprintf(buf, buflen, "vendor=0x%04x device=0x%04x subvendor=0x%04x " 4582 "subdevice=0x%04x class=0x%02x%02x%02x", cfg->vendor, cfg->device, 4583 cfg->subvendor, cfg->subdevice, cfg->baseclass, cfg->subclass, 4584 cfg->progif); 4585 return (0); 4586 } 4587 4588 int 4589 pci_assign_interrupt_method(device_t dev, device_t child) 4590 { 4591 struct pci_devinfo *dinfo = device_get_ivars(child); 4592 pcicfgregs *cfg = &dinfo->cfg; 4593 4594 return (PCIB_ROUTE_INTERRUPT(device_get_parent(dev), child, 4595 cfg->intpin)); 4596 } 4597 4598 static int 4599 pci_modevent(module_t mod, int what, void *arg) 4600 { 4601 static struct cdev *pci_cdev; 4602 4603 switch (what) { 4604 case MOD_LOAD: 4605 STAILQ_INIT(&pci_devq); 4606 pci_generation = 0; 4607 pci_cdev = make_dev(&pcicdev, 0, UID_ROOT, GID_WHEEL, 0644, 4608 "pci"); 4609 pci_load_vendor_data(); 4610 break; 4611 4612 case MOD_UNLOAD: 4613 destroy_dev(pci_cdev); 4614 break; 4615 } 4616 4617 return (0); 4618 } 4619 4620 void 4621 pci_cfg_restore(device_t dev, struct pci_devinfo *dinfo) 4622 { 4623 4624 /* 4625 * Only do header type 0 devices. Type 1 devices are bridges, 4626 * which we know need special treatment. Type 2 devices are 4627 * cardbus bridges which also require special treatment. 4628 * Other types are unknown, and we err on the side of safety 4629 * by ignoring them. 4630 */ 4631 if ((dinfo->cfg.hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 4632 return; 4633 4634 /* 4635 * Restore the device to full power mode. We must do this 4636 * before we restore the registers because moving from D3 to 4637 * D0 will cause the chip's BARs and some other registers to 4638 * be reset to some unknown power on reset values. Cut down 4639 * the noise on boot by doing nothing if we are already in 4640 * state D0. 4641 */ 4642 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D0) 4643 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 4644 pci_restore_bars(dev); 4645 pci_write_config(dev, PCIR_COMMAND, dinfo->cfg.cmdreg, 2); 4646 pci_write_config(dev, PCIR_INTLINE, dinfo->cfg.intline, 1); 4647 pci_write_config(dev, PCIR_INTPIN, dinfo->cfg.intpin, 1); 4648 pci_write_config(dev, PCIR_MINGNT, dinfo->cfg.mingnt, 1); 4649 pci_write_config(dev, PCIR_MAXLAT, dinfo->cfg.maxlat, 1); 4650 pci_write_config(dev, PCIR_CACHELNSZ, dinfo->cfg.cachelnsz, 1); 4651 pci_write_config(dev, PCIR_LATTIMER, dinfo->cfg.lattimer, 1); 4652 pci_write_config(dev, PCIR_PROGIF, dinfo->cfg.progif, 1); 4653 pci_write_config(dev, PCIR_REVID, dinfo->cfg.revid, 1); 4654 4655 /* Restore MSI and MSI-X configurations if they are present. */ 4656 if (dinfo->cfg.msi.msi_location != 0) 4657 pci_resume_msi(dev); 4658 if (dinfo->cfg.msix.msix_location != 0) 4659 pci_resume_msix(dev); 4660 } 4661 4662 void 4663 pci_cfg_save(device_t dev, struct pci_devinfo *dinfo, int setstate) 4664 { 4665 uint32_t cls; 4666 int ps; 4667 4668 /* 4669 * Only do header type 0 devices. Type 1 devices are bridges, which 4670 * we know need special treatment. Type 2 devices are cardbus bridges 4671 * which also require special treatment. Other types are unknown, and 4672 * we err on the side of safety by ignoring them. Powering down 4673 * bridges should not be undertaken lightly. 4674 */ 4675 if ((dinfo->cfg.hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 4676 return; 4677 4678 /* 4679 * Some drivers apparently write to these registers w/o updating our 4680 * cached copy. No harm happens if we update the copy, so do so here 4681 * so we can restore them. The COMMAND register is modified by the 4682 * bus w/o updating the cache. This should represent the normally 4683 * writable portion of the 'defined' part of type 0 headers. In 4684 * theory we also need to save/restore the PCI capability structures 4685 * we know about, but apart from power we don't know any that are 4686 * writable. 4687 */ 4688 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_0, 2); 4689 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_0, 2); 4690 dinfo->cfg.vendor = pci_read_config(dev, PCIR_VENDOR, 2); 4691 dinfo->cfg.device = pci_read_config(dev, PCIR_DEVICE, 2); 4692 dinfo->cfg.cmdreg = pci_read_config(dev, PCIR_COMMAND, 2); 4693 dinfo->cfg.intline = pci_read_config(dev, PCIR_INTLINE, 1); 4694 dinfo->cfg.intpin = pci_read_config(dev, PCIR_INTPIN, 1); 4695 dinfo->cfg.mingnt = pci_read_config(dev, PCIR_MINGNT, 1); 4696 dinfo->cfg.maxlat = pci_read_config(dev, PCIR_MAXLAT, 1); 4697 dinfo->cfg.cachelnsz = pci_read_config(dev, PCIR_CACHELNSZ, 1); 4698 dinfo->cfg.lattimer = pci_read_config(dev, PCIR_LATTIMER, 1); 4699 dinfo->cfg.baseclass = pci_read_config(dev, PCIR_CLASS, 1); 4700 dinfo->cfg.subclass = pci_read_config(dev, PCIR_SUBCLASS, 1); 4701 dinfo->cfg.progif = pci_read_config(dev, PCIR_PROGIF, 1); 4702 dinfo->cfg.revid = pci_read_config(dev, PCIR_REVID, 1); 4703 4704 /* 4705 * don't set the state for display devices, base peripherals and 4706 * memory devices since bad things happen when they are powered down. 4707 * We should (a) have drivers that can easily detach and (b) use 4708 * generic drivers for these devices so that some device actually 4709 * attaches. We need to make sure that when we implement (a) we don't 4710 * power the device down on a reattach. 4711 */ 4712 cls = pci_get_class(dev); 4713 if (!setstate) 4714 return; 4715 switch (pci_do_power_nodriver) 4716 { 4717 case 0: /* NO powerdown at all */ 4718 return; 4719 case 1: /* Conservative about what to power down */ 4720 if (cls == PCIC_STORAGE) 4721 return; 4722 /*FALLTHROUGH*/ 4723 case 2: /* Agressive about what to power down */ 4724 if (cls == PCIC_DISPLAY || cls == PCIC_MEMORY || 4725 cls == PCIC_BASEPERIPH) 4726 return; 4727 /*FALLTHROUGH*/ 4728 case 3: /* Power down everything */ 4729 break; 4730 } 4731 /* 4732 * PCI spec says we can only go into D3 state from D0 state. 4733 * Transition from D[12] into D0 before going to D3 state. 4734 */ 4735 ps = pci_get_powerstate(dev); 4736 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 4737 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 4738 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D3) 4739 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 4740 } 4741 4742 /* Wrapper APIs suitable for device driver use. */ 4743 void 4744 pci_save_state(device_t dev) 4745 { 4746 struct pci_devinfo *dinfo; 4747 4748 dinfo = device_get_ivars(dev); 4749 pci_cfg_save(dev, dinfo, 0); 4750 } 4751 4752 void 4753 pci_restore_state(device_t dev) 4754 { 4755 struct pci_devinfo *dinfo; 4756 4757 dinfo = device_get_ivars(dev); 4758 pci_cfg_restore(dev, dinfo); 4759 } 4760 4761 /* Find the upstream port of a given PCI device in a root complex. */ 4762 device_t 4763 pci_find_pcie_root_port(device_t dev) 4764 { 4765 struct pci_devinfo *dinfo; 4766 devclass_t pci_class; 4767 device_t pcib, bus; 4768 4769 pci_class = devclass_find("pci"); 4770 KASSERT(device_get_devclass(device_get_parent(dev)) == pci_class, 4771 ("%s: non-pci device %s", __func__, device_get_nameunit(dev))); 4772 4773 /* 4774 * Walk the bridge hierarchy until we find a PCI-e root 4775 * port or a non-PCI device. 4776 */ 4777 for (;;) { 4778 bus = device_get_parent(dev); 4779 KASSERT(bus != NULL, ("%s: null parent of %s", __func__, 4780 device_get_nameunit(dev))); 4781 4782 pcib = device_get_parent(bus); 4783 KASSERT(pcib != NULL, ("%s: null bridge of %s", __func__, 4784 device_get_nameunit(bus))); 4785 4786 /* 4787 * pcib's parent must be a PCI bus for this to be a 4788 * PCI-PCI bridge. 4789 */ 4790 if (device_get_devclass(device_get_parent(pcib)) != pci_class) 4791 return (NULL); 4792 4793 dinfo = device_get_ivars(pcib); 4794 if (dinfo->cfg.pcie.pcie_location != 0 && 4795 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) 4796 return (pcib); 4797 4798 dev = pcib; 4799 } 4800 }
Cache object: e184637969b80c395f92b13b0e6abf54
[ source navigation ] [ diff markup ] [ identifier search ] [ freetext search ] [ file search ] [ list types ] [ track identifier ]